簡要描述:Thermo Scientific 產(chǎn)品服務(wù)科學(xué)。從常規(guī)分析到前沿領(lǐng)域,我們的創(chuàng)新技術(shù)可以幫助科學(xué)家們應(yīng)對復(fù)雜的分析挑戰(zhàn),使他們能夠按照自己的方式開展所需的工作。產(chǎn)品領(lǐng)域包括實(shí)驗(yàn)室設(shè)備、實(shí)驗(yàn)室塑料器具、質(zhì)譜、色譜、分子生物學(xué)、蛋白質(zhì)生物學(xué)、臨床和診斷等。Thermo Thermo life TLE3 ANTIBODY 100 microliter
相關(guān)文章
Related Articles詳細(xì)介紹
品牌 | 其他品牌 | 供貨周期 | 現(xiàn)貨 |
---|
Thermo life TLE3 ANTIBODY 100 microliter
Thermo life TLE3 ANTIBODY 100 microliter
張經(jīng)理 Q821536999
Thermo-life | 4484453 | TOTAL EXOSOME ISO(OTHER BODY FLUIDS) | ¥3,643.00 | FLUIDS) |
Thermo-life | H10120 | GT FAB'2 X HU IGG FC AF 488 1 ML | ¥3,643.00 | 1 ML |
Thermo-life | K155002 | RIBOMINUS (HUMAN/MOUSE) 6 RXNS | ¥3,643.00 | 6 RXNS |
Thermo-life | MHCD0431 | MS ANTI HU CD4 PERCP 0.5 ML | ¥3,643.00 | 0.5 ML |
Thermo-life | MHCD45RO31 | MS ANTI HU CD45RO PERCP 0.5 ML | ¥3,643.00 | 0.5 ML |
Thermo-life | RM5228 | RT ANTI MS CD31 PAC BLUE 1 ML | ¥3,643.00 | 1 ML |
Thermo-life | S34860 | SYTOX GREEN DEAD CELL STAIN 1 ML | ¥3,643.00 | 1 ML |
Thermo-life | A10072 | RED/GREEN BODIPY PC-A2 100 UG | ¥3,645.00 | 100 UG |
Thermo-life | D1845 | DEXTRAN, FLUORESCEIN, 40, 25 MG | ¥3,645.00 | 25 MG |
Thermo-life | 410637 | KIT,FMOC GLU(OTB)1MMOL BX/10 EACH | ¥3,647.00 | EACH |
Thermo-life | D1818 | DEXTRAN, TETRAMETHYLRHODA 25 MG | ¥3,648.00 | 25 MG |
Thermo-life | 701640 | PSAMONO701640 100 UG | ¥3,649.00 | 100 UG |
Thermo-life | 701684 | ATG12MONO701684 100 UG | ¥3,649.00 | 100 UG |
Thermo-life | 701698 | FOXA2MONO701698 100 UG | ¥3,649.00 | 100 UG |
Thermo-life | 701746 | IRS1(PS312)MONO701746 100 UG | ¥3,649.00 | 100 UG |
Thermo-life | 701845 | RPS6PSPS240/244MONO701845 100 UG | ¥3,649.00 | 100 UG |
Thermo-life | 701942 | RAC1PS71OLIGO701942 100 UG | ¥3,649.00 | 100 UG |
Thermo-life | 701948 | OTX2MONO701948 100 UG | ¥3,649.00 | 100 UG |
Thermo-life | 710695 | HTTTOTALOLIGO710695 100 UG | ¥3,649.00 | 100 UG |
Thermo-life | 710746 | ATROLIGO710746 100 UG | ¥3,649.00 | 100 UG |
Thermo-life | 710753 | CHK2PS33/35OLIGO710753 100 UG | ¥3,649.00 | 100 UG |
Thermo-life | 710798 | H3K36ME1OLIGO710798 100 UG | ¥3,649.00 | 100 UG |
Thermo-life | 710802 | H3K79ME2OLIGO710802 100 UG | ¥3,649.00 | 100 UG |
Thermo-life | 710815 | H3K9ME2OLIGO710815 100 UG | ¥3,649.00 | 100 UG |
Thermo-life | 710830 | H2AK5ACOLIGO710830 100 UG | ¥3,649.00 | 100 UG |
Thermo-life | 710862 | KINDLINOLIGO710862 100 UG | ¥3,649.00 | 100 UG |
Thermo-life | 710879 | FOXO3AOLIGO710879 100 UG | ¥3,649.00 | 100 UG |
Thermo-life | 710901 | KMT2DOLIGO710901 100 UG | ¥3,649.00 | 100 UG |
Thermo-life | 710928 | JAKPY1007/1008OLIGO710928 100 UG | ¥3,649.00 | 100 UG |
Thermo-life | 710963 | GLUTAMINESYNTHETASEOLIGO710963 100 UG | ¥3,649.00 | 100 UG |
Thermo-life | 710968 | SSTOLIGO710968 100 UG | ¥3,649.00 | 100 UG |
Thermo-life | 710980 | LMX1AOLIGO710980 100 UG | ¥3,649.00 | 100 UG |
Thermo-life | 710997 | GLUTAMINASEOLIGO710997 100 UG | ¥3,649.00 | 100 UG |
Thermo-life | 711012 | NOTCH2OLIGO711012 100 UG | ¥3,649.00 | 100 UG |
Thermo-life | 711025 | NEUROFILAMENTHOLIGO711025 100 UG | ¥3,649.00 | 100 UG |
Thermo-life | 711031 | CHAPSYNOLIGO711031 100 UG | ¥3,649.00 | 100 UG |
Thermo-life | 711054 | FOX3OLIGO711054 100 UG | ¥3,649.00 | 100 UG |
Thermo-life | 720016 | TIF1BETAPOLY720016 100 UG | ¥3,649.00 | 100 UG |
Thermo-life | 720029 | HTTPOLY720029 100 UG | ¥3,649.00 | 100 UG |
Thermo-life | 720031 | FOXP2POLY720031 100 UG | ¥3,649.00 | 100 UG |
Thermo-life | 720043 | VEGFR1POLY720043 UG | ¥3,649.00 | UG |
Thermo-life | 720069 | H3K27ME3POLY720069 100 UG | ¥3,649.00 | 100 UG |
Thermo-life | 720107 | ATRPS428POLY720107 100 UG | ¥3,649.00 | 100 UG |
Thermo-life | 720115 | CYCLINEPS88POLY720115 100 UG | ¥3,649.00 | 100 UG |
Thermo-life | 720148 | H2AUBPOLY720148 100 UG | ¥3,649.00 | 100 UG |
Thermo-life | 720166 | HISTONEH4POLY720166 100 UG | ¥3,649.00 | 100 UG |
Thermo-life | 720172 | MSX1POLY720172 100 UG | ¥3,649.00 | 100 UG |
Thermo-life | 720179 | PLEXINA2POLY720179 100 UG | ¥3,649.00 | 100 UG |
Thermo-life | 720194 | OMGPPOLY720194 100 UG | ¥3,649.00 | 100 UG |
Thermo-life | 720297 | BUBR1POLY720297 UG | ¥3,649.00 | UG |
Thermo-life | 740001 | FLAGSUPER740001 100 UG | ¥3,649.00 | 100 UG |
Thermo-life | 711065 | MECP2OLIGO711065 100 UG | ¥3,649.00 | 100 UG |
Thermo-life | 701663 | HTTTOTALMONO701663 100 UG | ¥3,649.00 | 100 UG |
Thermo-life | 701767 | H3K36ME2MONO701767 100 UG | ¥3,649.00 | 100 UG |
Thermo-life | 701783 | H3K9ME2MONO701783 100 UG | ¥3,649.00 | 100 UG |
Thermo-life | 701847 | FOXO3AMONO701847 100 UG | ¥3,649.00 | 100 UG |
Thermo-life | 701869 | KMT2DMONO701869 100 UG | ¥3,649.00 | 100 UG |
Thermo-life | 701879 | RNF20MONO701879 100 UG | ¥3,649.00 | 100 UG |
Thermo-life | 701884 | KLF1MONO701884 100 UG | ¥3,649.00 | 100 UG |
Thermo-life | 701888 | KLF9MONO701888 100 UG | ¥3,649.00 | 100 UG |
Thermo-life | 701895 | JAK2PY1007/1008MONO701895 100 UG | ¥3,649.00 | 100 UG |
Thermo-life | 701935 | SSTMONO701935 100 UG | ¥3,649.00 | 100 UG |
Thermo-life | 701965 | GLUTAMINASEMONO701965 100 UG | ¥3,649.00 | 100 UG |
Thermo-life | 701980 | NOTCH2MONO701980 100 UG | ¥3,649.00 | 100 UG |
Thermo-life | 701985 | TRKCMONO701985 100 UG | ¥3,649.00 | 100 UG |
Thermo-life | 701989 | GLUTAMINASESYNTHETASEMONO70198 100 UG | ¥3,649.00 | 100 UG |
Thermo-life | 701993 | NEUROFILAMENTHMONO701993 100 UG | ¥3,649.00 | 100 UG |
Thermo-life | 701999 | CHAPSYN110MONO701999 100 UG | ¥3,649.00 | 100 UG |
Thermo-life | 702017 | TPH2MONO702017 100 UG | ¥3,649.00 | 100 UG |
Thermo-life | 702022 | FOX3MONO702022 100 UG | ¥3,649.00 | 100 UG |
Thermo-life | 702433 | ATG12ATG5MONO702433 100 UG | ¥3,649.00 | 100 UG |
Thermo-life | 702434 | JAK2MONO702434 100 UG | ¥3,649.00 | 100 UG |
Thermo-life | 710781 | IRS1(PS636/PS639)OLIGO710781 100 UG | ¥3,649.00 | 100 UG |
Thermo-life | 710799 | H3K36ME2OLIGO710799 100 UG | ¥3,649.00 | 100 UG |
Thermo-life | 710805 | H3K79ACOLIGO710805 100 UG | ¥3,649.00 | 100 UG |
Thermo-life | 710859 | APCOLIGO710859 100 UG | ¥3,649.00 | 100 UG |
Thermo-life | 710921 | KLF9OLIGO710921 100 UG | ¥3,649.00 | 100 UG |
Thermo-life | 710971 | SPECTRINBETA3OLIGO710971 100 UG | ¥3,649.00 | 100 UG |
Thermo-life | 711020 | EAAT2OLIGO711020 100 UG | ¥3,649.00 | 100 UG |
Thermo-life | 711072 | FGF1OLIGO711072 100 UG | ¥3,649.00 | 100 UG |
Thermo-life | 711090 | STATHMIN1OLIGO711090 100 UG | ¥3,649.00 | 100 UG |
Thermo-life | 711215 | OSTEOPONTINOLIGO711215 100 UG | ¥3,649.00 | 100 UG |
Thermo-life | 711274 | RHOBOLIGO711274 100 UG | ¥3,649.00 | 100 UG |
Thermo-life | 711292 | FKBP5OLIGO711292 100 UG | ¥3,649.00 | 100 UG |
Thermo-life | 711309 | TNFRSF25OLIGO711309 100 UG | ¥3,649.00 | 100 UG |
Thermo-life | 720277 | GPR68POLY720277 100 UG | ¥3,649.00 | 100 UG |
Thermo-life | 720278 | GHSRPOLY720278 100 UG | ¥3,649.00 | 100 UG |
Thermo-life | 720279 | GCGRPOLY720279 100 UG | ¥3,649.00 | 100 UG |
Thermo-life | 720284 | DRD5POLY720284 100 UG | ¥3,649.00 | 100 UG |
Thermo-life | 720286 | GPR56POLY720286 100 UG | ¥3,649.00 | 100 UG |
Thermo-life | 720288 | BDKRB2POLY720288 100 UG | ¥3,649.00 | 100 UG |
Thermo-life | 720289 | AVPR1APOLY720289 100 UG | ¥3,649.00 | 100 UG |
Thermo-life | 720290 | CRHR1POLY720290 100 UG | ¥3,649.00 | 100 UG |
Thermo-life | 720291 | CRHR2POLY720291 100 UG | ¥3,649.00 | 100 UG |
Thermo-life | 720293 | FPR2POLY720293 100 UG | ¥3,649.00 | 100 UG |
Thermo-life | 720295 | MC4RPOLY720295 100 UG | ¥3,649.00 | 100 UG |
Thermo-life | 720296 | CALCRPOLY720296 100 UG | ¥3,649.00 | 100 UG |
Thermo-life | 4367033 | ASSY,PPH FOR TUBES&STRIPS SPR EACH | ¥3,650.00 | EACH |
Thermo-life | C2210 | 5-CARBOXYFLUORESCEIN, SUC 10 MG | ¥3,651.00 | 10 MG |
Thermo-life | F14201 | FLUO-4, AM CELL PERMEANT 10 X 50 UG | ¥3,652.00 | 10 X 50 UG |
Thermo-life | F6774 | FURA-2 CALCIUM IMAGING CA 1 KIT | ¥3,652.00 | 1 KIT |
Thermo-life | S34855 | SYTO BC GREEN FLUORESC 100 UL | ¥3,652.00 | 100 UL |
Thermo-life | 50300 | HISTOMOUSE BEAT BLOCKER 2X6 ML | ¥3,652.00 | 2X6 ML |
Thermo-life | 50310M08B25 | RECOM MS KYNU (HIS) 25UG | ¥3,653.00 | 25UG |
Thermo-life | 133700 | MOUSE ANTI-PKC-BETA 100 UG | ¥3,657.00 | 100 UG |
Thermo-life | 370800 | MOUSE ANTI-NPI-1 100 UG | ¥3,657.00 | 100 UG |
Thermo-life | 433310 | MS ANTI-IL-8 (GUINEA PIG) 100 UG | ¥3,657.00 | 100 UG |
Thermo-life | 4335613 | 3730 BUFFER(10X) W/EDTA 500ML EACH | ¥3,659.00 | EACH |
Thermo-life | 701457 | SMA MONO AB-701457 100 UG | ¥3,659.00 | 100 UG |
Thermo-life | 710504 | PIM-1 OLIGO AB-710504 100 UG | ¥3,659.00 | 100 UG |
Thermo-life | 710512 | STAM OLIGO AB-710512 100 UG | ¥3,659.00 | 100 UG |
Thermo-life | 710515 | BCL2 OLIGO AB-710515 100 UG | ¥3,659.00 | 100 UG |
Thermo-life | 710523 | C-KIT OLIGO AB-710523 100 UG | ¥3,659.00 | 100 UG |
Thermo-life | 710530 | RFP OLIGO AB-710530 100 UG | ¥3,659.00 | 100 UG |
Thermo-life | 710543 | RAB4 OLIGO AB-710543 100 UG | ¥3,659.00 | 100 UG |
Thermo-life | M10165 | MARINA BLUE(R) SUCCINIMID 5 MG | ¥3,659.00 | 5 MG |
Thermo-life | 19534050 | STREPTAVIDIN-HRP .05ML PER VIA EACH | ¥3,661.00 | EACH |
Thermo-life | 956543B | HISTOSTAIN-SP KIT (MOUSE, HRP, 110 ML | ¥3,661.00 | 110 ML |
Thermo-life | 959943B | HISTOSTAIN-SP KIT (HRP, 1000 S 110 ML | ¥3,661.00 | 110 ML |
Thermo-life | MHTDT012 | MS X HU TDT FITC 0.2 ML | ¥3,661.00 | 0.2 ML |
Thermo-life | V13243 | MEMBRANE PERMEABILITY/DEAD CE 1 KIT | ¥3,661.00 | 1 KIT |
Thermo-life | CD2904 | HU CD29 PE 0.5 ML | ¥3,662.00 | 0.5 ML |
Thermo-life | MHTLR220 | MS X HU TLR2 AF 488 0.5 ML | ¥3,662.00 | 0.5 ML |
Thermo-life | D1976 | DEXTRAN, CASCADE BLUE, 25 MG | ¥3,663.00 | 25 MG |
Thermo-life | 40039V08B25 | RECOM V FUSION GLYCOPROTEIN F0 25UG | ¥3,664.00 | 25UG |
Thermo-life | D1822 | DEXTRAN, FLUORESCEIN, 70, 25 MG | ¥3,666.00 | 25 MG |
Thermo-life | D1956 | DEXTRAN, BIOTIN, 10,000 M 25 MG | ¥3,666.00 | 25 MG |
Thermo-life | IB801001 | IBLOT DNA TRANSFER STACKS 10 BLOTS PER SKU | ¥3,666.00 | 10 BLOTS PER SKU |
Thermo-life | PRC1066 | REC RT GRO 25 UG BIOSOURCE (TM) | ¥3,666.00 | 25 UG BIOSOURCE (TM) |
Thermo-life | 471712 | A-23 SSP UNITRAY W/TAQ 12TESTS 12 TESTS | ¥3,666.00 | 12 TESTS |
Thermo-life | 472712 | B21 SSP UNITRAY W/TAQ 12 TESTS 12 TESTS | ¥3,666.00 | 12 TESTS |
Thermo-life | MCD0824 | MS CD8A PE-AF 700 1 ML | ¥3,668.00 | 1 ML |
Thermo-life | PHC9634 | REC HU EPO 10 UG 10 UG | ¥3,669.00 | 10 UG |
Thermo-life | HM4028 | HA ANTI MS CD69 PAC BLUE 1.0 ML | ¥3,670.00 | 1.0 ML |
Thermo-life | MCD11C28 | HA ANTI MS CD11C PAC BLUE 1.0 ML | ¥3,670.00 | 1.0 ML |
Thermo-life | MHCD3004 | HU CD30 PE 0.5 ML | ¥3,670.00 | 0.5 ML |
Thermo-life | P130 | 1-PYRENEBUTANOIC ACID, SU 100 MG | ¥3,670.00 | 100 MG |
Thermo-life | RM6028 | RT ANTI MS CD25 PAC BLUE 1 ML | ¥3,670.00 | 1 ML |
Thermo-life | RM90128 | RT ANTI MS TNF ALPHA PAC BLUE 1 ML | ¥3,670.00 | 1 ML |
Thermo-life | D7137 | DEXTRAN, FLUORESCEIN, 2,0 10 MG | ¥3,672.00 | 10 MG |
Thermo-life | 10246H08H25 | RECOM HU MIF (HIS) 25UG | ¥3,673.00 | 25UG |
Thermo-life | 10451H08B50 | RECOM HU KITLG (HIS) ACTIVE 50 UG | ¥3,673.00 | 50 UG |
Thermo-life | D1863 | DEXTRAN, TEXAS RED, 10 25 MG | ¥3,673.00 | 25 MG |
Thermo-life | 4377153 | TEMPUS 12-PORT RNA ISOLATN PLASTICS | ¥3,674.00 | PLASTICS |
Thermo-life | 4467477 | LYOPHILIZED ASAYS MM,ENDO CTL FAST STRIP | ¥3,674.00 | FAST STRIP |
Thermo-life | Y7530 | YEAST MITOCHONDRIAL STAIN 1 KIT | ¥3,674.00 | 1 KIT |
Thermo-life | A40691 | 5TAMRA OD 41-45 | ¥3,675.00 | OD 41-45 |
Thermo-life | D338 | 4,4-DIISOTHIOCYANATODIHY 100 MG | ¥3,676.00 | 100 MG |
Thermo-life | F1225 | FURA-2, AM 1 MM SOLUTION 1 ML | ¥3,677.00 | 1 ML |
Thermo-life | 855211DE | SC SERV PDEST17 GATEWAY EA | ¥3,678.00 | EA |
Thermo-life | A13203 | ANNEXIN V, ALEXA FLUOR(R) 500 UL | ¥3,678.00 | 500 UL |
Thermo-life | MCD04043 | MS CD4 PE 3 ML | ¥3,678.00 | 3 ML |
Thermo-life | RM6221 | MS CD117 (C-KIT) AF 647 1 ML | ¥3,678.00 | 1 ML |
Thermo-life | 63102 | DYNABEADS DNA DIRECT BLOOD KIT | ¥3,679.00 | KIT |
Thermo-life | 4415328 | VETMAX RT-PCR EACH | ¥3,682.00 | EACH |
Thermo-life | 50487M08B50 | RECOM MS KITL (HIS) ACTIVE 50 UG | ¥3,682.00 | 50 UG |
Thermo-life | A11255 | SECORE CUSTOM GSSP KIT RUO 25 REACTIONS | ¥3,682.00 | 25 REACTIONS |
Thermo-life | 12574030 | SS III ONE-STEP HI FI 25 RXN 25 REACTIONS | ¥3,685.00 | 25 REACTIONS |
Thermo-life | M3733 | MAGNESIUM GREEN(TM), PENT 1 MG | ¥3,685.00 | 1 MG |
Thermo-life | MHCD0831 | MS ANTI HU CD8 PERCP 0.5 ML | ¥3,686.00 | 0.5 ML |
Thermo-life | B1550 | BIOTIN DHPE 10 MG | ¥3,687.00 | 10 MG |
Thermo-life | B30466 | BODIPY TMR C5 MALEIMIDE 1 MG | ¥3,687.00 | 1 MG |
Thermo-life | AM16708 | SILENCER PRE-DESIGNED SIRNA 5NMOL | ¥3,687.00 | 5NMOL |
Thermo-life | 855005DE | SC SERV CUSTOMER VECTOR EA | ¥3,688.00 | EA |
Thermo-life | 855101DE | SC SERV PDONR221 GATEWAY EA | ¥3,688.00 | EA |
Thermo-life | 855102DE | SC SERV PDONR ZEO GATEWAY EA | ¥3,688.00 | EA |
Thermo-life | 855241DE | SC SERV PCDNA 3.2 V5 DEST GW EA | ¥3,688.00 | EA |
Thermo-life | 855242DE | SC SERV PCDNA DEST40 GATEWAY EA | ¥3,688.00 | EA |
Thermo-life | 855243DE | SC SERV PLENTI 6.3 V5 DEST GW EA | ¥3,688.00 | EA |
Thermo-life | 855311DE | SC SERV PRSET A EA | ¥3,688.00 | EA |
Thermo-life | 855312DE | SC SERV PRSET B EA | ¥3,688.00 | EA |
Thermo-life | 855314DE | SC SERV PBAD HIS A EA | ¥3,688.00 | EA |
Thermo-life | 855322DE | SC SERV PFASTBAC HT B EA | ¥3,688.00 | EA |
Thermo-life | 855324DE | SC SERV PFASTBAC 1 EA | ¥3,688.00 | EA |
Thermo-life | 855331DE | SC SERV PPICZ ALPHA A EA | ¥3,688.00 | EA |
Thermo-life | 855333DE | SC SERV PPICZ ALPHA C EA | ¥3,688.00 | EA |
Thermo-life | 855341DE | SC SERV PCDNA 3.1 PLUS EA | ¥3,688.00 | EA |
Thermo-life | 855342DE | SC SERV PCDNA 3.1 HYGRO PLUS EA | ¥3,688.00 | EA |
Thermo-life | 855343DE | SC SERV PCDNA 3.1 ZEO PLUS EA | ¥3,688.00 | EA |
Thermo-life | 855344DE | SC SERV PCDNA5 FRT EA | ¥3,688.00 | EA |
Thermo-life | RM2629 | MS CD45R (B220) AF 700 1.0 ML | ¥3,688.00 | 1.0 ML |
Thermo-life | 4481195 | 384W PLATE BC GPLE QTY 50 EACH | ¥3,688.00 | EACH |
Thermo-life | N24191 | NEWPORT GREEN PDX ACE 1 MG | ¥3,688.00 | 1 MG |
Thermo-life | RP43154 | OSTEOCALCIN (BOVINE) EA | ¥3,689.00 | EA |
Thermo-life | 10052H08H25 | RECOM HU IL12B (HIS) 25UG | ¥3,690.00 | 25UG |
Thermo-life | A13207 | 5PRIME FAM,3PRIME TAMRA OD 16-20 | ¥3,690.00 | OD 16-20 |
Thermo-life | A13212 | 5PRIME FAM,3PRIME DABCYL OD 16-20 | ¥3,690.00 | OD 16-20 |
Thermo-life | 11746100 | SYBR ONE-STEP SUPERMIX W/ROX 100 X 50UL REACTIONS | ¥3,691.00 | 100 X 50UL REACTIONS |
Thermo-life | C7001 | CELLTRACKER CM-DII 1 MG | ¥3,691.00 | 1 MG |
Thermo-life | AM2271 | RNASE A (AFFINITY PURIFIED) 1MG (1 MG/ML) | ¥3,692.00 | 1MG (1 MG/ML) |
Thermo-life | 100001861 | RNA HPLC IN VIVO 20 NMOL 20 NMOL | ¥3,693.00 | 20 NMOL |
Thermo-life | 4304405 | ASSY,SMP GEL LOADER 377 EACH | ¥3,693.00 | EACH |
Thermo-life | MCD0417 | MS CD4 PE-TR 0.5 ML | ¥3,696.00 | 0.5 ML |
Thermo-life | 4449079 | STAB BLD-TO-CT NA PREP 50 RXN | ¥3,697.00 | 50 RXN |
Thermo-life | D23107 | DIHYDROETHIDIUM (HYDROETH 1 ML | ¥3,697.00 | 1 ML |
Thermo-life | 12684015 | ALGIMATRIX 3D 1X96 WELL PLATE EA | ¥3,698.00 | EA |
Thermo-life | D3883 | DIA;4-DI-16-ASP 25 MG | ¥3,698.00 | 25 MG |
Thermo-life | MCD0418 | MS CD4 PE-CY5.5 0.5 ML | ¥3,698.00 | 0.5 ML |
Thermo-life | MCD0422 | MS CD4 PE-AF 610 1 ML | ¥3,698.00 | 1 ML |
Thermo-life | MCD0821 | MS CD8A AF 647 1 ML | ¥3,698.00 | 1 ML |
Thermo-life | MCD0827 | MS CD8A APC-AF 750 1 ML | ¥3,698.00 | 1 ML |
Thermo-life | MF48027 | RT X MS F4/80 APC-AF 750 1 ML | ¥3,698.00 | 1 ML |
Thermo-life | AM7152 | RNA 6000 LADDER 3 X 20UL (FOR CALIPER) | ¥3,698.00 | (FOR CALIPER) |
Thermo-life | Y7531 | YEAST VACUOLE MARKER SAMP 1 KIT | ¥3,699.00 | 1 KIT |
Thermo-life | 451203 | DRB3 SSP UNITRAY 12 TESTS 12 TESTS | ¥3,699.00 | 12 TESTS |
Thermo-life | 470303 | B-44 SSP UNITRAY 12 TESTS 12 TESTS | ¥3,699.00 | 12 TESTS |
Thermo-life | 470403 | B-07 SSP UNITRAY 12 TESTS 12 TESTS | ¥3,699.00 | 12 TESTS |
Thermo-life | 54110D | ALLSET GOLD A*02 HIGH RES SSP 10 TESTS | ¥3,699.00 | 10 TESTS |
Thermo-life | 541150D | ALLSET GOLD B*38/39 HIGH RES 10 TESTS | ¥3,699.00 | 10 TESTS |
Thermo-life | 54130D | ALLSET GOLD A19 HIGH RES SSP 10 TESTS | ¥3,699.00 | 10 TESTS |
Thermo-life | 54140D | ALLSET GOLD B35 HIGH RES SSP 10 TESTS | ¥3,699.00 | 10 TESTS |
Thermo-life | 54150D | ALLSET GOLD B*44/45 HIGH RES SSP 10 TESTS | ¥3,699.00 | SSP 10 TESTS |
Thermo-life | 54180D | ALLSET GOLD B*51/52 HIGH RES SSP 10 TESTS | ¥3,699.00 | SSP 10 TESTS |
Thermo-life | 54250D | ALLSET GOLD DRB1-08/12 HR SSP 10 TESTS | ¥3,699.00 | 10 TESTS |
Thermo-life | D291 | 4-(4-(DIDECYLAMINO)STYRYL 25 MG | ¥3,706.00 | 25 MG |
Thermo-life | MSCA21 | RT X MS LY-6A/E (SCA-1) AF 647 1 ML | ¥3,706.00 | 1 ML |
Thermo-life | PV4377 | FLUORESCEIN-UBIQUITIN 50 UG | ¥3,706.00 | 50 UG |
Thermo-life | PV4379 | BIOTIN UBIQUITIN 10 UG | ¥3,706.00 | 10 UG |
Thermo-life | PV5693 | ALEXA FLUOR 647-POLY GT, 30 UM 1 NMOL | ¥3,706.00 | 1 NMOL |
Thermo-life | RM2621 | MS CD45R (B220) AF 647 1 ML | ¥3,706.00 | 1 ML |
Thermo-life | RM3021 | RT X MS GR-1, LY-6C/G AF 647 1 ML | ¥3,706.00 | 1 ML |
Thermo-life | 4457087 | VIIA 7 384-WELL PLATE ADAPTOR EACH | ¥3,707.00 | EACH |
Thermo-life | 11736051 | SYBR 1-STEP QRT-PCR KIT, 100 100 RXN | ¥3,708.00 | 100 RXN |
Thermo-life | 4007 | DATA ANALYSIS REPORTS ? | ¥3,708.00 | ? |
Thermo-life | 4463019 | SOLID REV1 RNA SP KIT EACH | ¥3,708.00 | EACH |
Thermo-life | 4463020 | SOLID REV1 DNA SP KIT EACH | ¥3,708.00 | EACH |
Thermo-life | 11746H20B50 | RECOM HU PDE1B (N-HIS&GST) 50UG | ¥3,710.00 | 50UG |
Thermo-life | 4440211 | MNL,USERS IDENTIFILER PLUS EACH | ¥3,712.00 | EACH |
Thermo-life | E074000UA | BOVINE THROMBIN 0.1MU | ¥3,712.00 | 0.1MU |
Thermo-life | PHC9484 | REC HU LIF 10UG 10ug | ¥3,712.00 | 10ug |
Thermo-life | MHZAP7031 | MS ANTI HU ZAP 70 PERCP 0.5 ML | ¥3,712.00 | 0.5 ML |
Thermo-life | D6251 | 5 4 4 4-DIFLUORO 5 2 5 MG | ¥3,713.00 | 5 MG |
Thermo-life | 753023 | MAXARRAYTM BREAST RECEPTOR CON 1 BLOCK | ¥3,714.00 | 1 BLOCK |
Thermo-life | B1616 | BIOTIN-X DHPE 5 MG | ¥3,715.00 | 5 MG |
Thermo-life | MF48021 | RT X MS F4/80 AF 647 1 ML | ¥3,715.00 | 1 ML |
Thermo-life | 1010513 | ZYSORBIN, 100ML 100 ML | ¥3,715.00 | 100 ML |
Thermo-life | 11738010 | PRIMER 5'BDA FL 200 NMOL 200 NMOL | ¥3,716.00 | 200 NMOL |
Thermo-life | Q20348 | QSY 35 IODOACETAMIDE 5 MG | ¥3,716.00 | 5 MG |
Thermo-life | N7991 | NEWPORT GREEN DCF DIA 1 MG | ¥3,718.00 | 1 MG |
Thermo-life | 4443263 | GENEMAPPER ID-X SW DOCS V1.2 KIT | ¥3,719.00 | KIT |
Thermo-life | AMEP4691 | PLATE, 160X110MM OPEN, MOUNT EACH | ¥3,719.00 | EACH |
Thermo-life | AMEPVH021 | HOLDER, SLIDES, DUAL, RETENT EACH | ¥3,719.00 | EACH |
Thermo-life | AMEPVH022 | HOLDER, PLATES, RETENTION EACH | ¥3,719.00 | EACH |
Thermo-life | 4415125 | MNL,IDENTIFILR DIRECT AMPFLSTR USERS | ¥3,720.00 | USERS |
Thermo-life | A13202 | ANNEXIN V, ALEXA FLUOR 500 UL | ¥3,722.00 | 500 UL |
Thermo-life | A23202 | ANNEXIN V, ALEXA FLUOR 500 UL | ¥3,722.00 | 500 UL |
Thermo-life | A23204 | ANNEXIN V, ALEXA FLUOR 500 UL | ¥3,722.00 | 500 UL |
Thermo-life | D23806 | DIHYDRORHODAMINE 123 5 M 1 ML | ¥3,722.00 | 1 ML |
Thermo-life | Q20132 | QSY(R) 21 CARBOXYLIC ACID 5 MG | ¥3,722.00 | 5 MG |
Thermo-life | MCD0421 | MS CD4 AF 647 1 ML | ¥3,724.00 | 1 ML |
Thermo-life | 4304982 | CUSTOM TAILED PRIMER PAIR 300K PMOLES | ¥3,725.00 | 300K PMOLES |
Thermo-life | 4352407 | TAQMAN FAST REAGENTS STARTER KIT | ¥3,725.00 | KIT |
Thermo-life | 4445552 | UNMETHYLATE/METHYLATE CRTL KIT EA | ¥3,725.00 | EA |
Thermo-life | D632 | DIHYDRORHODAMINE 123 10 MG | ¥3,725.00 | 10 MG |
Thermo-life | C369 | 5-(AND-6)-CARBOXY-2',7'-D 100 MG | ¥3,727.00 | 100 MG |
Thermo-life | PA548108 | AIF 100 ΜG | ¥3,727.00 | 100 ΜG |
Thermo-life | PA548109 | MSK2 / RSK-B 100 ΜG | ¥3,727.00 | 100 ΜG |
Thermo-life | PA548110 | PPP1R10 50 ΜG | ¥3,727.00 | 50 ΜG |
Thermo-life | PA548111 | SHP-2 / PTPN11 100 ΜG | ¥3,727.00 | 100 ΜG |
Thermo-life | 4401509 | SW,MS OEM OFFICE BASIC 2007 W/MEDIA | ¥3,728.00 | W/MEDIA |
Thermo-life | 4329538 | SNAPSHOT PRIMER FOCUS EACH | ¥3,729.00 | EACH |
Thermo-life | B438 | BIS-(1,3-DIBUTYLBARBITURI 25 MG | ¥3,729.00 | 25 MG |
Thermo-life | 81222 | MOUSE ANTI-E-CADHERIN (CLONE H 6 ML | ¥3,730.00 | 6 ML |
Thermo-life | 956143B | HISTOSTAIN-SP KIT (RABBIT, HRP 110 ML | ¥3,730.00 | 110 ML |
Thermo-life | A24509 | DKXMU AP HIGH XADS F(AB')2 0.5 mg | ¥3,730.00 | 0.5 mg |
Thermo-life | A24557 | GTXRT HIGH XADS F(AB')2 1 mg | ¥3,730.00 | 1 mg |
Thermo-life | B35000 | BACLIGHT GREEN BACTERIAL STAIN 20 X 50 UG | ¥3,730.00 | 20 X 50 UG |
Thermo-life | B413 | BIS-(1,3-DIETHYLTHIOBARBI 100 MG | ¥3,730.00 | 100 MG |
Thermo-life | H11001 | MIFEPRISTONE 100 UG | ¥3,730.00 | 100 UG |
Thermo-life | K202020 | PCR2.1 VECTOR 20 REACTIONS | ¥3,731.00 | 20 REACTIONS |
Thermo-life | PMC0134 | REC. MOUSE IL-13 10 UG BIOSOURCE (TM) | ¥3,731.00 | 10 UG BIOSOURCE (TM) |
Thermo-life | 450504D | DRB1-08 SSP UNITRAY 12 TESTS 12 TESTS | ¥3,731.00 | 12 TESTS |
Thermo-life | 472303 | B17 SSP UNITRAY 12 TESTS 12 TESTS | ¥3,731.00 | 12 TESTS |
Thermo-life | A1098201 | ALGIMATRIX 3D CS 1X6 WELL KIT 1 X 6 WELL | ¥3,732.00 | 1 X 6 WELL |
Thermo-life | CD0206 | HU CD2 TC 0.5 ML | ¥3,733.00 | 0.5 ML |
Thermo-life | EH03 | E-HOLDER 1 BOX = 2 E HOLDERS | ¥3,733.00 | 1 BOX = 2 E HOLDERS |
Thermo-life | MHCD8006 | HU CD80 (B7-1) TC 0.5 ML | ¥3,733.00 | 0.5 ML |
Thermo-life | C3047 | CALCIUM SPONGE(TM) S (BAP 1 G | ¥3,734.00 | 1 G |
Thermo-life | C111110 | PIR2 ONESHOT CHEN 10 RXN | ¥3,735.00 | 10 RXN |
Thermo-life | Q21931 | NBETA-(QSY(R) 35)-NALPHA- 5 MG | ¥3,735.00 | 5 MG |
Thermo-life | 18080200 | SS III CELlsIRECT 25 RXN 25 REACTIONS | ¥3,739.00 | 25 REACTIONS |
Thermo-life | RHCIL220 | RT X HU IL-2 AF 488 0.5 ML | ¥3,739.00 | 0.5 ML |
Thermo-life | V12883 | VYBRANT CFDA SE CELL T 1 KIT | ¥3,740.00 | 1 KIT |
Thermo-life | 702184 | OSTEOPONTINCLEAVEDMONO702184 100 UG | ¥3,741.00 | 100 UG |
Thermo-life | 702277 | DR3MONO702277 100 UG | ¥3,741.00 | 100 UG |
Thermo-life | 711007 | NOTCH3OLIGO711007 100 UG | ¥3,741.00 | 100 UG |
Thermo-life | 711143 | RBPS788OLIGO711143 100 UG | ¥3,741.00 | 100 UG |
Thermo-life | 711202 | CJUNOLIGO711202 100 UG | ¥3,741.00 | 100 UG |
Thermo-life | 711207 | CJUN(PT91/93/95)OLIGO711207 100 UG | ¥3,741.00 | 100 UG |
Thermo-life | 711233 | LAMININ211OLIGO711233 100 UG | ¥3,741.00 | 100 UG |
Thermo-life | 711304 | LAMININ221OLIGO711304 100 UG | ¥3,741.00 | 100 UG |
Thermo-life | 711306 | LAMININ322OLIGO711306 100 UG | ¥3,741.00 | 100 UG |
Thermo-life | 711319 | LAMININ213OLIGO711319 100 UG | ¥3,741.00 | 100 UG |
Thermo-life | 711323 | SMURF2OLIGO711323 100 UG | ¥3,741.00 | 100 UG |
Thermo-life | 711339 | CCL21OLIGO711339 100 UG | ¥3,741.00 | 100 UG |
Thermo-life | 711366 | CABLPY393ISOFORMAOLIGO711366 100 UG | ¥3,741.00 | 100 UG |
Thermo-life | 711368 | EGFRY1045OLIGO711368 100 UG | ¥3,741.00 | 100 UG |
Thermo-life | 711390 | HDAC4OLOLIGO711390 100 UG | ¥3,741.00 | 100 UG |
Thermo-life | 711421 | PUROMYCINTRNSFRSEOLIGO711421 100 UG | ¥3,741.00 | 100 UG |
Thermo-life | 711584 | SPECTRINBETA3WBOLIGO711584 100 UG | ¥3,741.00 | 100 UG |
Thermo-life | 720142 | PRMT6POLY720142 100 UG | ¥3,741.00 | 100 UG |
Thermo-life | 720220 | HOXA10POLY720220 100 UG | ¥3,741.00 | 100 UG |
Thermo-life | 720234 | CDCP1POLY720234 100 UG | ¥3,741.00 | 100 UG |
Thermo-life | 720237 | CYP2C9POLY720237 100 UG | ¥3,741.00 | 100 UG |
Thermo-life | 720240 | Proline Mechanical Pipettor,8-channel | ¥3,741.00 | |
Thermo-life | 720242 | FABP1POLY720242 100 UG | ¥3,741.00 | 100 UG |
Thermo-life | 720276 | DOPAMINERCPTRD1R696POLY720276 100 UG | ¥3,741.00 | 100 UG |
Thermo-life | 720285 | GPR55POLY720285 100 UG | ¥3,741.00 | 100 UG |
Thermo-life | MHCD4506 | HU CD45 TC 0.5 ML | ¥3,743.00 | 0.5 ML |
Thermo-life | C33372 | CLICK-IT BIOTIN PROTEIN ANALYS 1 KIT | ¥3,744.00 | 1 KIT |
Thermo-life | S6654 | SYPRO RED PROTEIN GEL 10 X 50 UL | ¥3,744.00 | 10 X 50 UL |
Thermo-life | A40548 | 5AMINOLINKER(C12) OD 36-40 | ¥3,746.00 | OD 36-40 |
Thermo-life | 4445585 | KIT,SW VIIA 7 RUO V1.0 EACH | ¥3,748.00 | EACH |
Thermo-life | 4453722 | SW,VIIA 7 RUO EACH | ¥3,748.00 | EACH |
Thermo-life | A15400 | RT X MS CD49E FITC 0.5 MG | ¥3,749.00 | 0.5 MG |
Thermo-life | A25865A | FOXP3 AB AND BUFFER KIT, PE KIT | ¥3,749.00 | KIT |
Thermo-life | 130400 | MOUSE ANTI-NEUROFILAMENT-L 100 UG | ¥3,750.00 | 100 UG |
Thermo-life | 130500 | MOUSE ANTI-NEUROFILAMENT-M 100 UG | ¥3,750.00 | 100 UG |
Thermo-life | 130600 | MOUSE ANTI-ZAP-70 100 UG | ¥3,750.00 | 100 UG |
Thermo-life | 132511 | MOUSE ANTI-C-MYC-FITC 100 UG | ¥3,750.00 | 100 UG |
Thermo-life | 132600 | MOUSE ANTI-FIBRONECTIN RECEPTO 100 UG | ¥3,750.00 | 100 UG |
Thermo-life | 133100 | MOUSE ANTI-FGF RECEPTOR 100 UG | ¥3,750.00 | 100 UG |
Thermo-life | 133600 | MOUSE ANTI-STAT5A 100 UG | ¥3,750.00 | 100 UG |
Thermo-life | 133800 | MOUSE ANTI-PKC-GAMMA 200 UG | ¥3,750.00 | 200 UG |
Thermo-life | 133900 | MOUSE ANTI-PCNA 200 UG | ¥3,750.00 | 200 UG |
Thermo-life | 134000 | MOUSE ANTI-P53 200 UG | ¥3,750.00 | 200 UG |
Thermo-life | 134100 | MOUSE ANTI-P53 100 UG | ¥3,750.00 | 100 UG |
Thermo-life | 135300 | MOUSE ANTI-STAT5B 100 UG | ¥3,750.00 | 100 UG |
Thermo-life | 137300 | MOUSE ANTI-CAM KINASE II 100 UG | ¥3,750.00 | 100 UG |
Thermo-life | 138800 | MOUSE ANTI-BCL-2 100 UG | ¥3,750.00 | 100 UG |
Thermo-life | 139800 | MOUSE ANTI-CAM KINASE II 100 UG | ¥3,750.00 | 100 UG |
Thermo-life | 321900 | MOUSE ANTI-NITROTYROSINE 100 UG | ¥3,750.00 | 100 UG |
Thermo-life | 322400 | MOUSE ANTI-CUL-1 100 UG | ¥3,750.00 | 100 UG |
Thermo-life | 326700 | MOUSE ANTI-HA 100 UG | ¥3,750.00 | 100 UG |
Thermo-life | 331800 | MOUSE ANTI-P34(CDC2) 100 UG | ¥3,750.00 | 100 UG |
Thermo-life | 332300 | MOUSE ANTI-STAT4 100 UG | ¥3,750.00 | 100 UG |
Thermo-life | 333400 | MOUSE ANTI-PHOSPHO-STAT1 50 UG | ¥3,750.00 | 50 UG |
Thermo-life | 333500 | MOUSE ANTI-CYCLIN D1 100 UG | ¥3,750.00 | 100 UG |
Thermo-life | 333800 | MOUSE ANTI-HSP-70 100 UG | ¥3,750.00 | 100 UG |
Thermo-life | 335000 | MOUSE ANTI-GAP-43 100 UG | ¥3,750.00 | 100 UG |
Thermo-life | 336100 | MOUSE ANTI-BCL-2 100 UG | ¥3,750.00 | 100 UG |
Thermo-life | 336400 | MOUSE ANTI-BAX (CLONE 2D2) 100 UG | ¥3,750.00 | 100 UG |
Thermo-life | 344200 | RABBIT ANTI-CONNEXIN 29 50 UG | ¥3,750.00 | 50 UG |
Thermo-life | 346300 | RABBIT ANTI-PHOSPHO-P27 (SER10 50 UG | ¥3,750.00 | 50 UG |
Thermo-life | 355200 | MOUSE ANTI-PHOSPHO-TAU (THR231 50 UG | ¥3,750.00 | 50 UG |
Thermo-life | 355300 | MOUSE ANTI-PHOSPHO-TAU (SER396 50 UG | ¥3,750.00 | 50 UG |
Thermo-life | 356000 | MOUSE ANTI-TYROSINASE 100 UG | ¥3,750.00 | 100 UG |
Thermo-life | 361900 | RABBIT ANTI-VE-CADHERIN 50 UG | ¥3,750.00 | 50 UG |
Thermo-life | 367100 | RABBIT ANTI-PEN-2 50 UG | ¥3,750.00 | 50 UG |
Thermo-life | 369700 | RABBIT ANTI-PHOSPHO-EGFR (TYR1 50 UG | ¥3,750.00 | 50 UG |
Thermo-life | 377500 | MOUSE ANTI-V5 TAG 100 UG | ¥3,750.00 | 100 UG |
Thermo-life | 382850 | RABBIT ANTI-PITX3 50 UG | ¥3,750.00 | 50 UG |
Thermo-life | 383350 | RABBIT ANTI-SENP1 50 UG | ¥3,750.00 | 50 UG |
Thermo-life | 384950 | RABBIT ANTI-C-FOS 50 UG | ¥3,750.00 | 50 UG |
Thermo-life | 392050 | MOUSE ANTI-VAV 1 0.5 ML | ¥3,750.00 | 0.5 ML |
Thermo-life | 44610 | GSK 3ALPHA/BETA MAB 100 UG BIOSOURCE (TM) | ¥3,750.00 | 100 UG BIOSOURCE (TM) |
Thermo-life | 511800 | RABBIT ANTI-CUL-2 100 UG | ¥3,750.00 | 100 UG |
Thermo-life | 511900 | RABBIT ANTI-SKP2 (P45) 100 UG | ¥3,750.00 | 100 UG |
Thermo-life | 512400 | RABBIT ANTI-PTEN 200 UG | ¥3,750.00 | 200 UG |
Thermo-life | 512700 | RABBIT ANTI-AMYLOID-BETA PRECU 50 UG/100UL | ¥3,750.00 | 50 UG/100UL |
Thermo-life | 512800 | RABBIT ANTI-CONNEXIN 26 50 UG | ¥3,750.00 | 50 UG |
Thermo-life | 513200 | RABBIT ANTI-IRF3 100 UG | ¥3,750.00 | 100 UG |
Thermo-life | 513300 | RABBIT ANTI-IRF7 100 UG | ¥3,750.00 | 100 UG |
Thermo-life | 516200 | RABBIT ANTI-CONNEXIN 36 (PAD C 50 UG | ¥3,750.00 | 50 UG |
Thermo-life | 516300 | RABBIT ANTI-CONNEXIN 36 (PAD C 50 UG | ¥3,750.00 | 50 UG |
Thermo-life | 617000 | RABBIT ANTI-NNOS 100 UG | ¥3,750.00 | 100 UG |
Thermo-life | 617400 | RABBIT ANTI-MAP KINASE (ERK1+E 100 UG | ¥3,750.00 | 100 UG |
Thermo-life | 700772 | DIGOXIGENIN ABFINITYMAB 100 UG | ¥3,750.00 | 100 UG |
Thermo-life | 700775 | GST ABFINITY RBT REC AB EA | ¥3,750.00 | EA |
Thermo-life | 710011 | GST RBT REC OLIGO AB EA | ¥3,750.00 | EA |
Thermo-life | 710019 | ANTI-DIGOXIG RBT REC OLIGO AB EA | ¥3,750.00 | EA |
Thermo-life | 710083 | FITC RBT REC OLIGO AB EACH | ¥3,750.00 | EACH |
Thermo-life | 710236 | HA RBT REC OLIGO AB EACH | ¥3,750.00 | EACH |
Thermo-life | 710369 | ALEXA FLUOR 488 OLIGOAB-710369 EACH | ¥3,750.00 | EACH |
Thermo-life | 710500 | RABBIT ANTI-CONNEXIN 26 50 UG | ¥3,750.00 | 50 UG |
Thermo-life | 710600 | RABBIT ANTI-CONNEXIN 32 (PAD Z 50 UG | ¥3,750.00 | 50 UG |
Thermo-life | 710700 | RABBIT ANTI-CONNEXIN 43 50 UG | ¥3,750.00 | 50 UG |
Thermo-life | 714500 | RABBIT ANTI-STAT4 100 UG | ¥3,750.00 | 100 UG |
Thermo-life | 718000 | RABBIT ANTI-C-MET 100 UG | ¥3,750.00 | 100 UG |
Thermo-life | 718600 | RABBIT ANTI-NMDA RECEPTOR 2B 100 UG | ¥3,750.00 | 100 UG |
Thermo-life | O6139 | OREGON GREEN(R) 514 CARBO 5 MG | ¥3,750.00 | 5 MG |
Thermo-life | 856031DE | READY-TO-WORK PREMIUM PREP TE 1 MG | ¥3,751.00 | 1 MG |
Thermo-life | 856032DE | READY-TO-WORK PREMIUM PREP H2O 1 MG | ¥3,751.00 | 1 MG |
Thermo-life | 856033DE | READY-TO-WORK PREMIUM PREP PBS 1 MG | ¥3,751.00 | 1 MG |
Thermo-life | 12034013 | MAX EFF DH5@ T1 COMP CELLS 1ML (5 X 0.2ML) | ¥3,752.00 | 1ML (5 X 0.2ML) |
Thermo-life | K1491BID | EPIJET 5-HMC ENRICHMENT KIT 25 RXNS | ¥3,752.00 | 25 RXNS |
Thermo-life | A13536EJ | DMEM 1 X 100L | ¥3,756.00 | 1 X 100L |
Thermo-life | A13564EJ | DMEM 1 X 100L | ¥3,756.00 | 1 X 100L |
Thermo-life | 180275 | MOUSE ANTI-BCL-10 (CLONE 151) 1 ML | ¥3,758.00 | 1 ML |
Thermo-life | MHCD1431 | MS ANTI HU CD14 PERCP 0.5 ML | ¥3,758.00 | 0.5 ML |
Thermo-life | MHCD1906 | HU CD19 TC 0.5 ML | ¥3,758.00 | 0.5 ML |
Thermo-life | MSCA18 | RT X MS LY-6A/E SCA-1 PE-CY5.5 0.5 ML | ¥3,758.00 | 0.5 ML |
Thermo-life | 730065 | ANTI-MBTD1 HU BIOT FAB-730065 EACH | ¥3,759.00 | EACH |
Thermo-life | 730066 | ANTI-ATAD2 HU BIOT FAB-730066 EACH | ¥3,759.00 | EACH |
Thermo-life | 730067 | ANTI-BRD7 HU BIOT FAB-730067 EACH | ¥3,759.00 | EACH |
Thermo-life | 730068 | ANTI-BAZ1B HU BIOT FAB-730068 EACH | ¥3,759.00 | EACH |
Thermo-life | 730071 | ANTI-PRDM9 HU BIOT FAB-730071 EACH | ¥3,759.00 | EACH |
Thermo-life | 730072 | ANTI-PRDM4 HU BIOT FAB-730072 EACH | ¥3,759.00 | EACH |
Thermo-life | A31852 | ANTI-GREEN FLUORESCENT PR 100 UL | ¥3,759.00 | 100 UL |
Thermo-life | C1430 | CALCEIN, AM 1 MG | ¥3,759.00 | 1 MG |
Thermo-life | 855221DE | SC SERV PDEST10 GATEWAY EA | ¥3,760.00 | EA |
Thermo-life | 855313DE | SC SERV PRSET C EA | ¥3,760.00 | EA |
Thermo-life | 855321DE | SC SERV PFASTBAC HT A EA | ¥3,760.00 | EA |
Thermo-life | 855334DE | SC SERV PYES 2 EA | ¥3,760.00 | EA |
Thermo-life | MCD0424 | MS CD4 PE-AF 700 1 ML | ¥3,760.00 | 1 ML |
Thermo-life | MCD0427 | MS CD4 APC-AF 750 1 ML | ¥3,760.00 | 1 ML |
Thermo-life | MCD0818 | MS CD8A PE-CY5.5 0.5 ML | ¥3,760.00 | 0.5 ML |
Thermo-life | MCD0822 | MS CD8A PE-AF 610 1 ML | ¥3,760.00 | 1 ML |
Thermo-life | MCD11C18 | MS CD11C PE-CY5.5 0.5 ML | ¥3,760.00 | 0.5 ML |
Thermo-life | RM2627 | MS CD45R B220 APC-AF 750 1 ML | ¥3,760.00 | 1 ML |
Thermo-life | RM2622 | MS CD45R (B220) PE-AF 610 1 ML | ¥3,760.00 | 1 ML |
Thermo-life | A28007 | TAQMAN ADV MICRORNA CDNA SYN 50 RXN | ¥3,760.00 | 50 RXN |
Thermo-life | F14203 | FLUO-5N, PENTAPOTASSIUM S 500 UG | ¥3,763.00 | 500 UG |
Thermo-life | AHC0939 | MS X HU IL 3(653A7D6)BIOTIN 0.1 MG BIOSOURCE (TM) | ¥3,764.00 | 0.1 MG BIOSOURCE (TM) |
Thermo-life | AHC2369 | MS X HU IP 10 (OD10) BIOTIN 0.1 MG BIOSOURCE (TM) | ¥3,764.00 | 0.1 MG BIOSOURCE (TM) |
Thermo-life | AMC0959 | RTXMS IL 5 TRFK 4 BIOTIN CONJ 0.1 MG BIOSOURCE (TM) | ¥3,764.00 | 0.1 MG BIOSOURCE (TM) |
Thermo-life | AMC4739 | MSXMS/RT IFN GAMMA BIOTIN(DB1) 0.1 MG BIOSOURCE (TM) | ¥3,764.00 | 0.1 MG BIOSOURCE (TM) |
Thermo-life | 10273H01H50 | RECOM HU PDGFC (HIGG1-FC) ACTI 50 UG | ¥3,765.00 | 50 UG |
Thermo-life | A25863A | FOXP3 AB AND BUFFER KIT, APC KIT | ¥3,766.00 | KIT |
Thermo-life | 4399670 | SIL SIRNA CUSTOM DSN, STD 5NM CUSTOM | ¥3,767.00 | CUSTOM |
Thermo-life | 431603301 | TAQMAN MGB PROBE 20000 PMOL | ¥3,768.00 | 20000 PMOL |
Thermo-life | 12684023 | ALGIMATRIX 3D 1X24 WELL PLATE EA | ¥3,769.00 | EA |
Thermo-life | P3028 | CYP2B6 BACULOSOMES PLUS 0.5 NMOL | ¥3,769.00 | 0.5 NMOL |
Thermo-life | D1168 | DIHYDROETHIDIUM (HYDROETH 25 MG | ¥3,770.00 | 25 MG |
Thermo-life | PMC1474 | REC MS 6 CKINE 20 UG BIOSOURCE (TM) | ¥3,770.00 | 20 UG BIOSOURCE (TM) |
Thermo-life | PMC1575 | REC MS MDC 20 UG BIOSOURCE (TM) | ¥3,770.00 | 20 UG BIOSOURCE (TM) |
Thermo-life | Q20133 | QSY(R) 35 ACETIC ACID, SU 5 MG | ¥3,770.00 | 5 MG |
Thermo-life | 1133903 | OLIGO R3 25ML BULK PACK EACH | ¥3,773.00 | EACH |
Thermo-life | 1954124 | SELF-PACK 4.6D/50L PK EACH | ¥3,773.00 | EACH |
Thermo-life | F2905 | FLUOREPORTER LACZ/GALACTOSIDAS 1 KIT | ¥3,773.00 | 1 KIT |
Thermo-life | MHCD4531 | MS ANTI HU CD45 PERCP 0.5 ML | ¥3,774.00 | 0.5 ML |
Thermo-life | ZM0025 | ZOOM AMPHOLYTES PH 4-6 10ML | ¥3,775.00 | 10ML |
Thermo-life | O6806 | OREGON GREEN 488 BAPTA 500 UG | ¥3,777.00 | 500 UG |
Thermo-life | MHCIFG05 | MS X HU IFN-GAMMA APC 0.5 ML | ¥3,778.00 | 0.5 ML |
Thermo-life | Q30457 | QSY(R) 9 C5-MALEIMIDE 5 MG | ¥3,778.00 | 5 MG |
Thermo-life | AM7886 | HU 293 TOTAL RNA 100UG (1 MG/ML) | ¥3,778.00 | (1 MG/ML) |
Thermo-life | W834 | WHEAT GERM AGGLUTININ, FL 5 MG | ¥3,779.00 | 5 MG |
Thermo-life | 10155HNAE50 | RECOM HU IL37 50UG | ¥3,781.00 | 50UG |
Thermo-life | 10526H08H50 | RECOM HU LBP (HIS) 50UG | ¥3,781.00 | 50UG |
Thermo-life | 10579HNAE50 | RECOM HU IL1F8 50UG | ¥3,781.00 | 50UG |
Thermo-life | 10607HNAE50 | RECOM HU IL1F6 50UG | ¥3,781.00 | 50UG |
Thermo-life | 11025H08H50 | RECOM HU IL22RA2 (HIS) 50UG | ¥3,781.00 | 50UG |
Thermo-life | 11223H08H25 | RECOM HU CHIT1 (HIS) 25UG | ¥3,781.00 | 25UG |
Thermo-life | 11596H08H50 | RECOM HU CSH1 (HIS) 50UG | ¥3,781.00 | 50UG |
Thermo-life | 12082H08H50 | RECOM HU PTX3 (HIS) 50UG | ¥3,781.00 | 50UG |
Thermo-life | 4462077 | VIIA 7 96-WELL TUBE ADAPTOR EACH | ¥3,781.00 | EACH |
Thermo-life | 4462078 | VIIA 7 FAST 96WELL TUBE ADAPTR EACH | ¥3,781.00 | EACH |
Thermo-life | 50213MNAE50 | RECOM MS IL1F5 50UG | ¥3,781.00 | 50UG |
Thermo-life | S37228 | SULFATE LATEX, 4% W/V 6 UM 15 ML | ¥3,781.00 | 15 ML |
Thermo-life | W6748 | WHEAT GERM AGGLUTININ, OR 5 MG | ¥3,781.00 | 5 MG |
Thermo-life | C21852 | CANDYCANE GLYCOPROTEI 400 UL | ¥3,782.00 | 400 UL |
Thermo-life | P33350 | PEPPERMINTSTICK PHOSP 400 UL | ¥3,783.00 | 400 UL |
Thermo-life | 180130 | RABBIT ANTI-SYNAPTOPHYSIN CONC 1 ML | ¥3,784.00 | 1 ML |
Thermo-life | 180221 | MOUSE ANTI-TTF-1 (CLONE 8G7G3/ 1 ML | ¥3,784.00 | 1 ML |
Thermo-life | 182403 | MOUSE ANTI-MDM2 (CLONE IF2) CO 0.2 ML | ¥3,784.00 | 0.2 ML |
Thermo-life | MHCD0412 | HU CD4 PE-CY7 0.5 ML | ¥3,784.00 | 0.5 ML |
Thermo-life | N52002 | PRIM,M13(-20)FORWARD 2 UG | ¥3,784.00 | 2 UG |
Thermo-life | 187379 | MOUSE ANTI-COX-2 (COX-229) CON 0.5 ML | ¥3,784.00 | 0.5 ML |
Thermo-life | R6029 | RHODAMINE RED C2 MALEIMIDE 5 MG | ¥3,786.00 | 5 MG |
Thermo-life | 4462113 | SEQUENCING STANDARD V1.1 3500 DX SERIES | ¥3,788.00 | DX SERIES |
Thermo-life | A2858501 | ESSENTIAL 8 FLEX MEDIUM KIT | ¥3,788.00 | KIT |
Thermo-life | MA523646 | AKT 100 TESTS | ¥3,788.00 | 100 TESTS |
Thermo-life | APS0309 | MS X MK CD3 BIOTIN CONJ 200 TESTS BIOSOURCE (TM) | ¥3,791.00 | 200 TESTS BIOSOURCE (TM) |
Thermo-life | O6185 | OREGON GREEN(R) 488-X, SU 5 MG | ¥3,791.00 | 5 MG |
Thermo-life | R64050 | COLUMNS,PURIFICATION BAG 50 EA | ¥3,792.00 | 50 EA |
Thermo-life | 33700 | MOUSE ANTI-BIOTIN 0.5MG | ¥3,793.00 | 0.5MG |
Thermo-life | A35108 | ANNEXIN V, ALEXA FLUOR 555 CON 500 UL | ¥3,793.00 | 500 UL |
Thermo-life | A35109 | ANNEXIN V, ALEXA FLUOR 680 CON 500 UL | ¥3,793.00 | 500 UL |
Thermo-life | A40740 | 3BIOTIN OD 81-90 | ¥3,793.00 | OD 81-90 |
Thermo-life | B35001 | BACLIGHT RED BACTERIAL STAIN S 20 X 50 UG | ¥3,793.00 | 20 X 50 UG |
Thermo-life | PHC9324 | HU IL-23, 10 UG 10 UG | ¥3,793.00 | 10 UG |
Thermo-life | 4473087 | TAQMAN MIRNA ABC PURIF HUMAN PANEL A | ¥3,794.00 | PANEL A |
Thermo-life | 4473088 | TAQMAN MIRNA ABC PURIF HUMAN PANEL B | ¥3,794.00 | PANEL B |
Thermo-life | 730069 | ANTI-PRMT3 HU BIOT FAB-730069 EACH | ¥3,795.00 | EACH |
Thermo-life | 730070 | ANTI-L3MBTL4 HU BIO FAB-730070 EACH | ¥3,795.00 | EACH |
Thermo-life | B6769 | BAPTA, AM CELL PERMEANT 20 X 1 MG | ¥3,795.00 | 20 X 1 MG |
Thermo-life | AM8050 | CAP ANALOG(M7G(5')PPP(5')G)25 A260U (40 MM) | ¥3,796.00 | A260U (40 MM) |
Thermo-life | N8010933 | MICROAMP OPTICAL TUBES W/O CAP , 0.2ML | ¥3,796.00 | , 0.2ML |
Thermo-life | Q10193 | QSY(R) 7 CARBOXYLIC ACID, 5 MG | ¥3,798.00 | 5 MG |
Thermo-life | C1165 | CDCFDA,SE 25 MG | ¥3,799.00 | 25 MG |
Thermo-life | 18004028 | T4 POLYNUCLEOTIDE KINASE 1000 UN | ¥3,800.00 | 1000 UN |
Thermo-life | 50448M08H25 | RECOM MS CPA1 (HIS) 25UG | ¥3,801.00 | 25UG |
Thermo-life | ZM0024 | ZOOM CARRIER AMPHOLYTES 9-11 10 ML | ¥3,801.00 | 10 ML |
Thermo-life | P30253 | PACIFIC ORANGE SUCCINIMIDYL ES 1 MG | ¥3,802.00 | 1 MG |
Thermo-life | ZM0023 | ZOOM CARRIER AMPHOLYTES 6-9 10 ML | ¥3,802.00 | 10 ML |
Thermo-life | 4459655 | CUSTOM MIRNA PREAMP POOL (12) EACH | ¥3,803.00 | EACH |
Thermo-life | 4459656 | CUSTOM MIRNA PREAMP POOL (16) EACH | ¥3,803.00 | EACH |
Thermo-life | 4459657 | CUSTOM MIRNA PREAMP POOL (24) EACH | ¥3,803.00 | EACH |
Thermo-life | 4459658 | CUSTOM MIRNA PREAMP POOL (32) EACH | ¥3,803.00 | EACH |
Thermo-life | 4459659 | CUSTOM MIRNA PREAMP POOL (48) EACH | ¥3,803.00 | EACH |
Thermo-life | 4459660 | CUSTOM MIRNA PREAMP POOL (64) EACH | ¥3,803.00 | EACH |
Thermo-life | 4459661 | CUSTOM MIRNA PREAMP POOL (96A) EACH | ¥3,803.00 | EACH |
Thermo-life | 4459662 | CUSTOM MIRNA PREAMP POOL (96B) EACH | ¥3,803.00 | EACH |
Thermo-life | 4478260 | CUSTOM MIRNA PREAMP POOL (384) | ¥3,803.00 | -384 |
Thermo-life | 855332DE | SC SERV PPICZ ALPHA B EA | ¥3,805.00 | EA |
Thermo-life | MHCD1406 | HU CD14 TC 0.5 ML | ¥3,805.00 | 0.5 ML |
Thermo-life | T6009 | TEXAS RED C5-BROMOACETAMIDE 5 MG | ¥3,806.00 | 5 MG |
Thermo-life | I9 | N-((2-(IODOACETOXY)ETHYL) 100 MG | ¥3,806.00 | 100 MG |
Thermo-life | IVGN2108 | ANZA T4 DNA LIGASE MASTER MIX EA | ¥3,807.00 | EA |
Thermo-life | S32358 | STREPTAVIDIN, ALEXA FLUOR 0.5 ML | ¥3,808.00 | 0.5 ML |
Thermo-life | MCD9001 | RT ANTI MS CD90 FITC 500 UG | ¥3,810.00 | 500 UG |
Thermo-life | MHCD4505 | HU CD45 APC 0.5 ML | ¥3,810.00 | 0.5 ML |
Thermo-life | ZM0022 | ZOOM CARRIER AMPHOLYTES 4-7 10 ML | ¥3,812.00 | 10 ML |
Thermo-life | 4338856 | TF,AMPLITAQ GOLD LD 250U KIT EACH | ¥3,813.00 | EACH |
Thermo-life | C3018 | CALCIUM CRIMSON AM 10 X 50 UG | ¥3,813.00 | 10 X 50 UG |
Thermo-life | G700801 | E-GEL 96 1% 8-PAK 1 EACH 8 GELS | ¥3,813.00 | 1 EACH 8 GELS |
Thermo-life | MHCD0505 | HU CD5 APC 0.5 ML | ¥3,813.00 | 0.5 ML |
Thermo-life | MHCD1605 | HU CD16 APC 0.5 ML | ¥3,813.00 | 0.5 ML |
Thermo-life | MHCD8304 | HU CD83 PE 0.5 ML | ¥3,813.00 | 0.5 ML |
Thermo-life | C33365 | CLICK-IT GALNAZ METABOLIC GLYC EACH | ¥3,814.00 | EACH |
Thermo-life | 30036578 | BSA FV IGG FREE FATTYACID POOR 100G | ¥3,816.00 | 100G |
Thermo-life | 879163 | SUPERPICTURE POLYMER KIT (MOUS 15 ML | ¥3,818.00 | 15 ML |
Thermo-life | 879963 | SUPERPICTURE POLYMER KIT (AEC, 15 ML | ¥3,818.00 | 15 ML |
Thermo-life | A15375 | MS X HU BCL-XL BIOTIN 0.1 MG | ¥3,818.00 | 0.1 MG |
Thermo-life | 11769015 | PRIMER 5'RGB 200 NMOL 200 NMOL | ¥3,819.00 | 200 NMOL |
Thermo-life | 11770013 | PRIMER 5'RGC 200 NMOL 200 NMOL | ¥3,819.00 | 200 NMOL |
Thermo-life | 4399240C | IVT EXPRESS10RXN 2PRT (901228-A&901228-D) | ¥3,819.00 | (901228-A&901228-D) |
Thermo-life | B10250 | BODIPY(R) FL N-(2-AMINOET 5 MG | ¥3,821.00 | 5 MG |
Thermo-life | S36002 | SINGLET OXYGEN SENSOR GREEN 10 X 100 UG | ¥3,822.00 | 10 X 100 UG |
Thermo-life | F23981 | FLUO-4FF, AM CELL PERMEA 10 X 50 UG | ¥3,823.00 | 10 X 50 UG |
Thermo-life | HM3621 | HA X MS TCR AB AF 647 1 ML | ¥3,823.00 | 1 ML |
Thermo-life | MHCD0705 | HU CD7 APC 0.5 ML | ¥3,823.00 | 0.5 ML |
Thermo-life | 12491023 | ADVANCED DMEM 10 X 500ML | ¥3,824.00 | 10 X 500ML |
Thermo-life | 12492021 | ADVANCED MEM 10 X 500ML | ¥3,824.00 | 10 X 500ML |
Thermo-life | 12633020 | ADVANCED RPMI 1640 10 X 500ML | ¥3,824.00 | 10 X 500ML |
Thermo-life | L3000008 | LIPOFECTAMINE 3000, 0.75ML 0.75mL | ¥3,825.00 | 0.75mL |
Thermo-life | S37225 | SULFATE LATEX, 4% W/V 4 UM 15 ML | ¥3,825.00 | 15 ML |
Thermo-life | M7512 | MITOTRACKER RED CMXROS 20 X 50 UG | ¥3,829.00 | 20 X 50 UG |
Thermo-life | 4472105 | SW LIC,DIGITALSUITE 1 LIC KIT | ¥3,830.00 | KIT |
Thermo-life | 471603 | B-39 SSP UNITRAY 12 TESTS 12 TESTS | ¥3,830.00 | 12 TESTS |
Thermo-life | 472503 | B22 SSP UNITRAY12 TESTS 12 TESTS | ¥3,830.00 | 12 TESTS |
Thermo-life | M22425 | MITOTRACKER RED FM 20 X 50 UG | ¥3,831.00 | 20 X 50 UG |
Thermo-life | A2952 | 3 AMINO 3 DEOXYDIGOXIGENI 5 MG | ¥3,832.00 | 5 MG |
Thermo-life | PMC0144 | REC MS EOTAXIN 2 20 UG BIOSOURCE (TM) | ¥3,832.00 | 20 UG BIOSOURCE (TM) |
Thermo-life | 11791023 | LR CLONASE II ENZ MIX-BD 10 REACTIONS, FOR BACULODIRECT | ¥3,833.00 | 10 REACTIONS, FOR BACULODIRECT |
Thermo-life | 12440061 | IMDM 10 X 500ML | ¥3,833.00 | 10 X 500ML |
Thermo-life | 4466606 | E-GEL IMAGER UNIVERSAL FILTER EACH | ¥3,833.00 | EACH |
Thermo-life | 4466607 | E-GEL IMAGER QDOT 625 FILTER EACH | ¥3,833.00 | EACH |
Thermo-life | 4466608 | E-GEL IMAGER UV SYBR FILTER EACH | ¥3,833.00 | EACH |
Thermo-life | M22426 | MITOTRACKER DEEP RED FM 20 X 50 UG | ¥3,833.00 | 20 X 50 UG |
Thermo-life | RHCIL205 | RT X HU IL-2 APC 0.5 ML | ¥3,833.00 | 0.5 ML |
Thermo-life | N8010612 | AUTOCLAVED RXN TUBES W/ CAP, 0.2ML | ¥3,833.00 | 0.2ML |
Thermo-life | 434422 | AVIDIN - AP 2 ML | ¥3,834.00 | 2 ML |
Thermo-life | 182410 | MOUSE ANTI-D2-40 CONCENTRATE 0.2 ML | ¥3,837.00 | 0.2 ML |
Thermo-life | 4457189 | TQMN MGB PROBE, SPECIAL 6 NMOL EACH | ¥3,837.00 | EACH |
Thermo-life | 4459845 | VIIA7 96-WELL PLATE ADAPTOR EACH | ¥3,837.00 | EACH |
Thermo-life | 810005DE | GENE CLONING GS 5 UG | ¥3,837.00 | 5 UG |
Thermo-life | 4488398C | COV(MERS) CONTROL SET EACH | ¥3,837.00 | EACH |
Thermo-life | C33367 | CLICK-IT GLCNAZ METABOLIC GLYC EACH | ¥3,838.00 | EACH |
Thermo-life | IVGN2404 | ANZA DNA BLUNTING KIT EA | ¥3,838.00 | EA |
Thermo-life | N56002 | PRIMER, T7 2 UG | ¥3,838.00 | 2 UG |
Thermo-life | Q20131 | QSY(R) 9 CARBOXYLIC ACID, 5 MG | ¥3,838.00 | 5 MG |
Thermo-life | T353 | TEXAS RED SULFONYL CHL 10 MG | ¥3,838.00 | 10 MG |
Thermo-life | 471103 | B-51 SSP UNITRAY 12 TESTS 12 TESTS | ¥3,838.00 | 12 TESTS |
Thermo-life | 855252DE | SC SERV CUSTOM CLONING II EA | ¥3,841.00 | EA |
Thermo-life | MHCD0406 | HU CD4 TC 0.5 ML | ¥3,841.00 | 0.5 ML |
Thermo-life | MHCD0706 | HU CD7 TC 0.5 ML | ¥3,841.00 | 0.5 ML |
Thermo-life | MHCD0806 | HU CD8 TC 0.5 ML | ¥3,841.00 | 0.5 ML |
Thermo-life | P3457 | PHALLOIDIN 1 MG | ¥3,841.00 | 1 MG |
Thermo-life | 855251DE | SC SERV PDEST CUSTOM GW VECTOR EA | ¥3,841.00 | EA |
Thermo-life | S37229 | SULFATE LATEX, 4% W/V 9 UM 15 ML | ¥3,841.00 | 15 ML |
Thermo-life | M7514 | MITOTRACKER GREEN FM 20 X 50 UG | ¥3,843.00 | 20 X 50 UG |
Thermo-life | 830143DE | SITE-DIR-MUT 3 - 4 KB 5 UG | ¥3,845.00 | 5 UG |
Thermo-life | 4478258 | CUSTOM MIRNA PREAMP POOL (192A) | ¥3,846.00 | (192A) |
Thermo-life | C1157 | 5(6)-CFDA,SE;CFSE 25 MG | ¥3,846.00 | 25 MG |
Thermo-life | MHCD1624 | HU CD16 PE-AF 700 0.5 ML | ¥3,846.00 | 0.5 ML |
Thermo-life | MHCD2031 | MS ANTI HU CD20 PERCP 0.5 ML | ¥3,846.00 | 0.5 ML |
Thermo-life | A24906DG | T CELL SR MEDIA SUPPLEMENT 100 ML | ¥3,846.00 | 100 ML |
Thermo-life | 12125H07E50 | RECOM HU FTO (N-HIS) 50UG | ¥3,847.00 | 50UG |
Thermo-life | G661808 | E-GEL CLONEWELL 0.8% SYBR SA EACH | ¥3,850.00 | EACH |
Thermo-life | MHCD0306 | HU CD3 TC 0.5 ML | ¥3,850.00 | 0.5 ML |
Thermo-life | MHCD10306 | HU CD103 TC 0.5 ML | ¥3,850.00 | 0.5 ML |
Thermo-life | PV6034 | EU-ANTI-DYKDDDDK ANTIBODY KIT EA | ¥3,850.00 | EA |
Thermo-life | AM1935 | LCM STAINING KIT 80 SLIDES (2PT) | ¥3,850.00 | (2PT) |
Thermo-life | 27250018 | TRYPSIN, 1/250 100G | ¥3,851.00 | 100G |
Thermo-life | POOL1010MLN | 10 POOL KIT- STRAWS & SYRINGES 1000 TESTS | ¥3,854.00 | 1000 TESTS |
Thermo-life | S37227 | SULFATE LATEX, 4% W/V 5 UM 15 ML | ¥3,854.00 | 15 ML |
Thermo-life | 18288019 | MAX EFF DH5@F' IQ COMP CELLS 1.0 ML (5 X 0.2ML) #18288 | ¥3,855.00 | 1.0 ML (5 X 0.2ML) #18288 |
Thermo-life | 21850029 | POLYMYXIN B SULFATE 25MU | ¥3,855.00 | 25MU |
Thermo-life | 450031 | ZERO BLUNT TOPO 4 SEQUENCING 25 RXN | ¥3,855.00 | 25 RXN |
Thermo-life | M36008 | MITOSOX RED MITOCHONDRIAL SUPE 10 X 50 UG | ¥3,855.00 | 10 X 50 UG |
Thermo-life | 10139HNAE50 | RECOM HU IL1B 50UG | ¥3,856.00 | 50UG |
Thermo-life | 4478359 | FG, TOTAL EXOSOME ISOL (CELLS) EACH | ¥3,856.00 | EACH |
Thermo-life | S6651 | SYPRO ORANGE PROTEIN G 10 X 50 UL | ¥3,856.00 | 10 X 50 UL |
Thermo-life | A30634 | ALEXA FLUOR 633 HYDRAZIDE 1 MG | ¥3,857.00 | 1 MG |
Thermo-life | 855212DE | SC SERV PBAD DEST49 GATEWAY EA | ¥3,858.00 | EA |
Thermo-life | 855231DE | SC SERV PYESDEST52 GATEWAY EA | ¥3,858.00 | EA |
Thermo-life | 855315DE | SC SERV PBAD HIS B EA | ¥3,858.00 | EA |
Thermo-life | 855316DE | SC SERV PBAD HIS C EA | ¥3,858.00 | EA |
Thermo-life | 855323DE | SC SERV PFASTBAC HT C EA | ¥3,858.00 | EA |
Thermo-life | 855325DE | SC SERV PFASTBAC DUAL EA | ¥3,858.00 | EA |
Thermo-life | MHCD0305 | HU CD3 APC 0.5 ML | ¥3,858.00 | 0.5 ML |
Thermo-life | MHCD1405 | HU CD14 APC 0.5 ML | ¥3,858.00 | 0.5 ML |
Thermo-life | MHCD5204 | HU CD52 PE 0.5 ML | ¥3,858.00 | 0.5 ML |
Thermo-life | MHCD5606 | HU CD56 TC 0.5 ML | ¥3,858.00 | 0.5 ML |
Thermo-life | S6900 | SODIUM GREEN(TM), TETRA(T 1 MG | ¥3,858.00 | 1 MG |
Thermo-life | 436800 | MS ANTI-MDM2 100 UG | ¥3,859.00 | 100 UG |
Thermo-life | 7103362100 | CS BIOTIN A-INSULIN 100UG 0.1 ML | ¥3,859.00 | 0.1 ML |
Thermo-life | A20502 | ALEXA FLUOR 647 HYDRAZ 1 MG | ¥3,859.00 | 1 MG |
Thermo-life | A21371 | ANTI-ALPHA-TUBULIN (BOVIN 50 UG | ¥3,859.00 | 50 UG |
Thermo-life | AHB0131 | GT X HU APP C TERMINAL SERA 100 UL BIOSOURCE (TM) | ¥3,859.00 | 100 UL BIOSOURCE (TM) |
Thermo-life | AHC0219 | MS X HU IL 1RA(A71B6D11)BIOTIN 0.1 MG BIOSOURCE (TM) | ¥3,859.00 | 0.1 MG BIOSOURCE (TM) |
Thermo-life | AHC0419 | MSXHU IL1ALPHA(840C20B8)BIOTIN 0.1 MG BIOSOURCE (TM) | ¥3,859.00 | 0.1 MG BIOSOURCE (TM) |
Thermo-life | AHC0469 | MS X HU IL 6(505E23C7)BIOTIN 0.1 MG BIOSOURCE (TM) | ¥3,859.00 | 0.1 MG BIOSOURCE (TM) |
Thermo-life | AHC0519 | MSXHU IL1BETA(508A3H12)BIOTIN 0.1 MG BIOSOURCE (TM) | ¥3,859.00 | 0.1 MG BIOSOURCE (TM) |
Thermo-life | AHC0789 | MS X HU IL 8(790A28G2)BIOTIN 0.1 MG BIOSOURCE (TM) | ¥3,859.00 | 0.1 MG BIOSOURCE (TM) |
Thermo-life | AHC3419 | MSXHU TNF ALPHA(68B3C5)BIOTIN 0.1 MG BIOSOURCE (TM) | ¥3,859.00 | 0.1 MG BIOSOURCE (TM) |
Thermo-life | AHC4114 | MSXHU IFN ALPHA 50 UG BIOSOURCE (TM) | ¥3,859.00 | 50 UG BIOSOURCE (TM) |
Thermo-life | AHC4539 | MSXHU IFNGAMMA(67F12A8)BIOTIN 0.1 MG BIOSOURCE (TM) | ¥3,859.00 | 0.1 MG BIOSOURCE (TM) |
Thermo-life | AHC7109 | MS X HU IL 10(945A5A10)BIOTIN 0.1 MG BIOSOURCE (TM) | ¥3,859.00 | 0.1 MG BIOSOURCE (TM) |
Thermo-life | AHC7129 | MS X HU IL 12(A25C4B6)BIOTIN 0.1 MG BIOSOURCE (TM) | ¥3,859.00 | 0.1 MG BIOSOURCE (TM) |
Thermo-life | AMC0949 | RTXMS IL 4 (BVD6 24G2) BIOTIN 0.1 MG BIOSOURCE (TM) | ¥3,859.00 | 0.1 MG BIOSOURCE (TM) |
Thermo-life | AMC3019 | RABBIT X MS TNF ALPHA BIOTIN 0.1 MG BIOSOURCE (TM) | ¥3,859.00 | 0.1 MG BIOSOURCE (TM) |
Thermo-life | ARC0829 | MS X RT IL 2 (12B11AE7) BIOTIN 0.1 MG BIOSOURCE (TM) | ¥3,859.00 | 0.1 MG BIOSOURCE (TM) |
Thermo-life | ARC9129 | MS X RT IL 12(A193D11C4)BIOTIN 0.1 MG BIOSOURCE (TM) | ¥3,859.00 | 0.1 MG BIOSOURCE (TM) |
Thermo-life | ASC0829 | MS X SW IL 2 BIOTIN 0.1 MG BIOSOURCE (TM) | ¥3,859.00 | 0.1 MG BIOSOURCE (TM) |
Thermo-life | ASC0849 | MS X SW IL 4 BIOTIN 0.1 MG BIOSOURCE (TM) | ¥3,859.00 | 0.1 MG BIOSOURCE (TM) |
Thermo-life | ASC9109 | MSXSW IL 10(945A1A926C2)BIOTIN 0.1 MG BIOSOURCE (TM) | ¥3,859.00 | 0.1 MG BIOSOURCE (TM) |
Thermo-life | 180224 | MOUSE ANTI-N-CADHERIN (CLONE 3 1 ML | ¥3,862.00 | 1 ML |
Thermo-life | 4444202 | 7900HT MAIN SDS SOFTWARE EACH | ¥3,862.00 | EACH |
Thermo-life | A1040206 | LR REACTION 48+ LR CLONING REACTION 48+ | ¥3,862.00 | LR CLONING REACTION 48+ |
Thermo-life | O6147 | OREGON GREEN(R) 488 CARBO 5 MG | ¥3,862.00 | 5 MG |
Thermo-life | S11228 | STREPTAVIDIN, CASCADE YEL 1 MG | ¥3,862.00 | 1 MG |
Thermo-life | AMPFOP100R | PLAN ACHRO 100X,1.25NA REFURB EACH | ¥3,862.00 | EACH |
Thermo-life | PHC7024 | REC HU NT 4 10 UG BIOSOURCE (TM) | ¥3,865.00 | 10 UG BIOSOURCE (TM) |
Thermo-life | PMC1614 | REC MS BLC 20 UG BIOSOURCE (TM) | ¥3,865.00 | 20 UG BIOSOURCE (TM) |
Thermo-life | 11508017 | TAQPCRX DNA POLYMERASE, RECOM 500 UN 95514, 52395 | ¥3,867.00 | 500 UN 95514, 52395 |
Thermo-life | 11754017 | PRIMER 5'CSB 200 NMOL 200 NMOL | ¥3,867.00 | 200 NMOL |
Thermo-life | 4340860 | 4 PK CAP A 450 ML (402220) EACH | ¥3,868.00 | EACH |
Thermo-life | 4340862 | 4 PK OXIDIZER 450 ML (401632) EACH | ¥3,868.00 | EACH |
Thermo-life | M7510 | MITOTRACKER ORANGE CMT 20 X 50 UG | ¥3,868.00 | 20 X 50 UG |
Thermo-life | 700856 | CDK4 ABFIN REC RB AB PUR 100 UG | ¥3,869.00 | 100 UG |
Thermo-life | 11749017 | PRIMER 5'BDL R6G 200 NMOL 200 NMOL | ¥3,871.00 | 200 NMOL |
Thermo-life | H185 | 7-HYDROXYCOUMARIN-3-CARBO 100 MG | ¥3,871.00 | 100 MG |
Thermo-life | 187430 | RABBIT ANTI-ZO-1 CONCENTRATE 0.5 ML | ¥3,872.00 | 0.5 ML |
Thermo-life | 4391528 | TQMN EXPRESS PLATE,CUSTOM 3X32 EACH | ¥3,872.00 | EACH |
Thermo-life | 4391529 | TQMN EXPRESS PLATE,CUSTOM 3X32 W/ENDO | ¥3,872.00 | W/ENDO |
Thermo-life | 4413259 | TQMN ARRAY 96-WELL FAST PLATE 3X32 | ¥3,872.00 | 3X32 |
Thermo-life | 4413260 | TQMN ARRAY 96-WELL FAST PLATE 3X32+ENDO | ¥3,872.00 | 3X32+ENDO |
Thermo-life | 879263 | SUPERPICTURE POLYMER KIT (RABB 15 ML | ¥3,872.00 | 15 ML |
Thermo-life | MHCD3920 | MS ANTI-HU CD39-AF488 0.5 ML | ¥3,872.00 | 0.5 ML |
Thermo-life | 10440H08H25 | RECOM HU ALPL (HIS) 25UG | ¥3,873.00 | 25UG |
Thermo-life | 13168H08H50 | RECOM HU CCDC134 (HIS) 50UG | ¥3,873.00 | 50UG |
Thermo-life | E18 | EOSIN-5-ISOTHIOCYANATE 100 MG | ¥3,876.00 | 100 MG |
Thermo-life | 1912505 | FRIT, PEEK, 4.6MM, 5-PACK EACH | ¥3,877.00 | EACH |
Thermo-life | F14221 | FLUO-5F, PENTAPOTASSIUM S 500 UG | ¥3,878.00 | 500 UG |
Thermo-life | G800802 | E-GEL 48 2% AGAROSE 8-PAK 8-PAK | ¥3,878.00 | 8-PAK |
Thermo-life | MHCD1631 | MS ANTI HU CD16 PERCP 0.5 ML | ¥3,878.00 | 0.5 ML |
Thermo-life | MHCD2205 | HU CD22 APC 0.5 ML | ¥3,878.00 | 0.5 ML |
Thermo-life | A10436 | ALEXA FLUOR 488 HYDRAZ 1 MG. | ¥3,879.00 | 1 MG. |
Thermo-life | P14313 | PHEN GREEN SK, DIACET 1 MG | ¥3,879.00 | 1 MG |
Thermo-life | 3053080001 | CAPTURESELECT HU IG LAMBDA LIG 1g | ¥3,880.00 | 1g |
Thermo-life | 3092870001 | CAPTURESELECT AAT LIG 1g | ¥3,880.00 | 1g |
Thermo-life | 3203000001 | CAPTURESELECT FIX LIG 1g | ¥3,880.00 | 1g |
Thermo-life | D13951 | N-(4,4-DIFLUORO-5,7-DIMET 25 UG | ¥3,880.00 | 25 UG |
Thermo-life | MHCD1920 | HU CD19 AF 488 0.5 ML | ¥3,881.00 | 0.5 ML |
Thermo-life | Q10464 | QSY(R) 7 AMINE, HYDROCHLO 5 MG | ¥3,881.00 | 5 MG |
Thermo-life | PHC3016 | REC. HUMAN TNF-ALPHA 50 UG BIOSOURCE (TM) | ¥3,883.00 | 50 UG BIOSOURCE (TM) |
Thermo-life | PRC0814 | REC. RAT IL-1 BETA 10 UG BIOSOURCE (TM) | ¥3,883.00 | 10 UG BIOSOURCE (TM) |
Thermo-life | 44478G | MEK7 (PSPT271/275) PAB GLYC 100 UL BIOSOURCE (TM) | ¥3,885.00 | 100 UL BIOSOURCE (TM) |
Thermo-life | S1531 | SUCCINIMIDYL 3-(2-PYRIDYL 100 MG | ¥3,885.00 | 100 MG |
Thermo-life | A10437 | ALEXA FLUOR 568 HYDRAZ 1 MG | ¥3,886.00 | 1 MG |
Thermo-life | A10438 | ALEXA FLUOR 594 HYDRAZ 1 MG | ¥3,886.00 | 1 MG |
Thermo-life | A10439 | ALEXA FLUOR(R) 350 HYDRAZ 5 MG | ¥3,886.00 | 5 MG |
Thermo-life | CD1005 | HU CD10 APC 0.5 ML | ¥3,886.00 | 0.5 ML |
Thermo-life | CD6405 | HU CD64 APC 0.5 ML | ¥3,886.00 | 0.5 ML |
Thermo-life | RM2618 | MS CD45R (B220) PE-CY5.5 0.5 ML | ¥3,886.00 | 0.5 ML |
Thermo-life | M14205 | MAG-FLUO-4, TETRAPOTASSIU 500 UG | ¥3,887.00 | 500 UG |
Thermo-life | 54410D | KIR GENOTYPING SSP KIT DRY 10 TESTS | ¥3,887.00 | 10 TESTS |
Thermo-life | 4366596 | TAQMAN(R) MICRORNA RT KIT 200 RXNS | ¥3,888.00 | 200 RXNS |
Thermo-life | 402220 | ACETIC ANHYD/PYR/THF 450ML EACH | ¥3,889.00 | EACH |
Thermo-life | 401632 | 0.02M IODINE/H20/PYR/THF 450ML | ¥3,889.00 | 450ML |
Thermo-life | CD0305 | HU CD3 APC 0.5 ML | ¥3,890.00 | 0.5 ML |
Thermo-life | CD11705 | HU CD117 APC 0.5 ML | ¥3,890.00 | 0.5 ML |
Thermo-life | PHC4014 | REC HU IFN ALPHA A PURE 5 UG BIOSOURCE (TM) | ¥3,891.00 | 5 UG BIOSOURCE (TM) |
Thermo-life | 10248H01H50 | RECOM HU LEFTYA (HIGG1-FC TAG 50UG | ¥3,892.00 | 50UG |
Thermo-life | 10593H07H50 | RECOM HU SOST (N-HIS) 50UG | ¥3,892.00 | 50UG |
Thermo-life | 11300H08H50 | RECOM HU SEMA5A (HIS) 50UG | ¥3,892.00 | 50UG |
Thermo-life | M300044 | GT X MS IGG HU ADS PE 2 ML | ¥3,892.00 | 2 ML |
Thermo-life | 4316161 | ORACLE STD EDITION NAMED USER EACH | ¥3,895.00 | EACH |
Thermo-life | MHCD0805 | HU CD8 APC 0.5 ML | ¥3,895.00 | 0.5 ML |
Thermo-life | AM7832 | HU K-562 TOTAL RNA 100UG (1 MG/ML) | ¥3,895.00 | (1 MG/ML) |
Thermo-life | AM7836 | HU HL-60 TOTAL RNA 100UG (1 MG/ML) | ¥3,895.00 | (1 MG/ML) |
Thermo-life | AM7846 | HU MCF-7 TOTAL RNA 100UG (1 MG/ML) | ¥3,895.00 | (1 MG/ML) |
Thermo-life | AM7858 | HU JURKAT TOTAL RNA 100UG (1 MG/ML) | ¥3,895.00 | (1 MG/ML) |
Thermo-life | AM7950 | TOTAL HU PLACENTA RNA 100UG (1 MG/ML) | ¥3,895.00 | (1 MG/ML) |
Thermo-life | AM7954 | HU PANCREAS TTL RNA 100UG (1 MG/ML) | ¥3,895.00 | (1 MG/ML) |
Thermo-life | AM7960 | HU LIVER TOTAL RNA 100UG (1 MG/ML) | ¥3,895.00 | (1 MG/ML) |
Thermo-life | AM7962 | HU BRAIN TOTAL RNA 100UG (1 MG/ML) | ¥3,895.00 | (1 MG/ML) |
Thermo-life | AM7966 | TOTAL HU HEART RNA 100UG (1 MG/ML) | ¥3,895.00 | (1 MG/ML) |
Thermo-life | AM7968 | TTL HU LUNG RNA 100UG (1 MG/ML) | ¥3,895.00 | (1 MG/ML) |
Thermo-life | AM7970 | HU SPLEEN TOTAL RNA 100UG (1 MG/ML) | ¥3,895.00 | (1 MG/ML) |
Thermo-life | AM7976 | HU KIDNEY TOTAL RNA 100UG (1 MG/ML) | ¥3,895.00 | (1 MG/ML) |
Thermo-life | AM7982 | SKELETAL MUSCLE TOTL 100UG (1 MG/ML) | ¥3,895.00 | (1 MG/ML) |
Thermo-life | AM7986 | HU COLON TOTAL RNA 100UG (1 MG/ML) | ¥3,895.00 | (1 MG/ML) |
Thermo-life | AM7988 | HU PROSTATE TTL RNA 100UG (1 MG/ML) | ¥3,895.00 | (1 MG/ML) |
Thermo-life | MCD0419 | MS CD4 APC-CY5.5 0.5 ML | ¥3,896.00 | 0.5 ML |
Thermo-life | 4309155 | FG,SYBR GREEN PCR MASTER MIX EACH | ¥3,897.00 | EACH |
Thermo-life | 4367659 | FG,POWER SYBR GREEN PCR MASTER MIX | ¥3,897.00 | MASTER MIX |
Thermo-life | 4398987 | CUSTOM TAQMAN SMALL RNA ASSAYS 10 | ¥3,897.00 | 10 |
Thermo-life | C34564 | CELLTRACE FAR RED 1 Kit | ¥3,898.00 | 1 Kit |
Thermo-life | C36950 | COUNTBRIGHT ABSOLUTE COUNTING 5 ML | ¥3,898.00 | 5 ML |
Thermo-life | F24180 | FLUOZIN(TM)-1, TRIPOTASSI 500 UG | ¥3,898.00 | 500 UG |
Thermo-life | C34567 | CELLTRACE YELLOW 1 KIT | ¥3,898.00 | 1 KIT |
Thermo-life | W10834 | WESTERNDOT 655 HISTAG 500 uL | ¥3,900.00 | 500 uL |
Thermo-life | 11814019 | MYCOPHENOLIC ACID 500MG | ¥3,901.00 | 500MG |
Thermo-life | PHC9264 | REC HU IL-31 10 UG | ¥3,901.00 | 10 UG |
Thermo-life | 10818H08H25 | RECOM HU CD38 (HIS) 25UG | ¥3,902.00 | 25UG |
Thermo-life | B153 | BIS ANS 4 4 DIANILINO 1 10 MG | ¥3,903.00 | 10 MG |
Thermo-life | C33366 | CLICK-IT MANNAZ METABOLIC GLYC EACH | ¥3,903.00 | EACH |
Thermo-life | MA523647 | MIP-1 ALPHA / CCL3 100 TESTS | ¥3,903.00 | 100 TESTS |
Thermo-life | MA523648 | FLT3 / CD135 100 TESTS | ¥3,903.00 | 100 TESTS |
Thermo-life | MA523649 | IL-1 BETA 100 TESTS | ¥3,903.00 | 100 TESTS |
Thermo-life | MA523650 | NESTIN 100 TESTS | ¥3,903.00 | 100 TESTS |
Thermo-life | MA523651 | IL-27 100 TESTS | ¥3,903.00 | 100 TESTS |
Thermo-life | MA523652 | IL-12 + IL-23 P19 100 TESTS | ¥3,903.00 | 100 TESTS |
Thermo-life | MA523653 | INTEGRIN ALPHA 7 100 TESTS | ¥3,903.00 | 100 TESTS |
Thermo-life | MA523654 | CD205 / LY75 100 TESTS | ¥3,903.00 | 100 TESTS |
Thermo-life | MA523655 | ICOS / CD278 100 TESTS | ¥3,903.00 | 100 TESTS |
Thermo-life | MA523656 | MANNOSE RECEPTOR / CD206 100 TESTS | ¥3,903.00 | 100 TESTS |
Thermo-life | PA546900 | IL-7 RECEPTOR ALPHA/CD127 100 TESTS | ¥3,903.00 | 100 TESTS |
Thermo-life | 12300067 | HYBRIDOMA SFM 1X10L | ¥3,904.00 | 1X10L |
Thermo-life | 373100 | MOUSE ANTI-EPHRIN-B1 100 UG | ¥3,904.00 | 100 UG |
Thermo-life | 4308323 | FG KIT,EXOGENOUS IPC RGNT VIC PROBE | ¥3,905.00 | VIC PROBE |
Thermo-life | Q10257 | QSY 7 C5-MALEIMIDE 5 MG | ¥3,905.00 | 5 MG |
Thermo-life | ZBEQCASD | APE50SD E.COLI O157 BEADS S/D 50 TESTS (50 SAMPLES) | ¥3,905.00 | 50 TESTS (50 SAMPLES) |
Thermo-life | ZBSQCASD | APS50SD SALMONELLA BEADS S/D 50 TESTS (50 SAMPLES) | ¥3,905.00 | 50 TESTS (50 SAMPLES) |
Thermo-life | PHZ1235 | RAPAMYCIN 5 mg | ¥3,906.00 | 5 mg |
Thermo-life | LCM0214 | LCM, CAPSURE HS LCM CAPS EACH | ¥3,906.00 | EACH |
Thermo-life | HM3428 | MS CD3 PB 1.0 ML | ¥3,907.00 | 1.0 ML |
Thermo-life | I7 | 2-(4'-(IODOACETAMIDO)ANIL 100 MG | ¥3,910.00 | 100 MG |
Thermo-life | AM9944 | X-GAL 1 G EACH | ¥3,913.00 | EACH |
Thermo-life | MHCD4305 | HU CD43 APC 0.5 ML | ¥3,914.00 | 0.5 ML |
Thermo-life | 3192990001 | CAPTURESELECT FVII LIG 1g | ¥3,915.00 | 1g |
Thermo-life | S888 | STREPTAVIDIN 5 MG | ¥3,915.00 | 5 MG |
Thermo-life | A13204 | ANNEXIN V, BIOTIN-X CONJU 500 UL | ¥3,916.00 | 500 UL |
Thermo-life | MHPERF21 | HU PERFORIN AF 647 0.5 ML | ¥3,916.00 | 0.5 ML |
Thermo-life | P30506 | PACIFIC BLUE C5-MALEIMIDE 1 MG | ¥3,916.00 | 1 MG |
Thermo-life | V13240 | SINGLE CHANNEL ANNEXIN V/DEAD 1 KIT | ¥3,916.00 | 1 KIT |
Thermo-life | 20292 | OPENARRAY PLATE GUIDE SET EACH | ¥3,919.00 | EACH |
Thermo-life | W7024 | WHEAT GERM AGGLUTININ SAM 1 KIT | ¥3,919.00 | 1 KIT |
Thermo-life | W7024 | RNAlater 2X WIP ml | ¥3,919.00 | N/A |
Thermo-life | 100001864 | RNA HPLC IN VIVO 20 NMOL 20 NMOL | ¥3,921.00 | 20 NMOL |
Thermo-life | 343500 | RABBIT ANTI-EPHRIN-B1 100 UG | ¥3,921.00 | 100 UG |
Thermo-life | 343700 | RABBIT ANTI-EPHRIN-A4 100 UG | ¥3,921.00 | 100 UG |
Thermo-life | 344800 | RABBIT ANTI-PROLACTIN RECEPTOR 100 UG | ¥3,921.00 | 100 UG |
Thermo-life | 375800 | MOUSE ANTI-AP-2ALPHA 100 UG | ¥3,921.00 | 100 UG |
Thermo-life | 380200 | RABBIT ANTI-POH1 (C-TERM) 100 UG | ¥3,921.00 | 100 UG |
Thermo-life | 382400 | RABBIT ANTI-PA28ALPHA (C-TERM) 100 UG | ¥3,921.00 | 100 UG |
Thermo-life | 384200 | RABBIT ANTI-AMPKGAMMA2 100 UG | ¥3,921.00 | 100 UG |
Thermo-life | 386800 | RABBIT ANTI-RSK2 (N-TERM) 100 UG | ¥3,921.00 | 100 UG |
Thermo-life | 44340 | BETA AMYLOID 43 PAB 25 UG BIOSOURCE (TM) | ¥3,921.00 | 25 UG BIOSOURCE (TM) |
Thermo-life | 44488 | VAV3 [PY173] PAB 10 BLOT BIOSOURCE (TM) | ¥3,921.00 | 10 BLOT BIOSOURCE (TM) |
Thermo-life | 44502 | C RAF [PS259] PAB 10 BLOT BIOSOURCE (TM) | ¥3,921.00 | 10 BLOT BIOSOURCE (TM) |
Thermo-life | 44830 | SHC [PYPY239/240] PAB 10 BLOT BIOSOURCE (TM) | ¥3,921.00 | 10 BLOT BIOSOURCE (TM) |
Thermo-life | 44969 | PKC ETA [PT655] PAB 10 BLOT BIOSOURCE (TM) | ¥3,921.00 | 10 BLOT BIOSOURCE (TM) |
Thermo-life | 701630 | CONNEXIN36MONO701630 100 UG | ¥3,921.00 | 100 UG |
Thermo-life | 701683 | TGFBR2MONO701683 100 UG | ¥3,921.00 | 100 UG |
Thermo-life | 701685 | ATG16LMONO701685 100 UG | ¥3,921.00 | 100 UG |
Thermo-life | 701696 | BNIP3MONO701696 100 UG | ¥3,921.00 | 100 UG |
Thermo-life | 701702 | JUNBMONO701702 100 UG | ¥3,921.00 | 100 UG |
Thermo-life | 701720 | CHK2(PT387)MONO701720 100 UG | ¥3,921.00 | 100 UG |
Thermo-life | 701735 | EGFR(PY1173)MONO701735 100 UG | ¥3,921.00 | 100 UG |
Thermo-life | 701760 | CMETPY1349MONO701760 100 UG | ¥3,921.00 | 100 UG |
Thermo-life | 701808 | CDK1PTPY14/15MONO701808 100 UG | ¥3,921.00 | 100 UG |
Thermo-life | 701814 | CYCLINE2MONO701814 100 UG | ¥3,921.00 | 100 UG |
Thermo-life | 701825 | ZO3MONO701825 UG | ¥3,921.00 | UG |
Thermo-life | 701830 | KINDLIN1MONO701830 100 UG | ¥3,921.00 | 100 UG |
Thermo-life | 701832 | CISMONO701832 UG | ¥3,921.00 | UG |
Thermo-life | 701856 | WNT2B/13MONO701856 100 UG | ¥3,921.00 | 100 UG |
Thermo-life | 701919 | MSSCA1MONO701919 100 UG | ¥3,921.00 | 100 UG |
Thermo-life | 701940 | SMAD7CTERMMONO701940 100 UG | ¥3,921.00 | 100 UG |
Thermo-life | 701949 | THMONO701949 100 UG | ¥3,921.00 | 100 UG |
Thermo-life | 710663 | CONNEXIN36OLIGO710663 100 UG | ¥3,921.00 | 100 UG |
Thermo-life | 710673 | PSAOLIGO710673 100 UG | ¥3,921.00 | 100 UG |
Thermo-life | 710715 | TGFBR2OLIGO710715 100 UG | ¥3,921.00 | 100 UG |
Thermo-life | 710716 | ATG12OLIGO710716 100 UG | ¥3,921.00 | 100 UG |
Thermo-life | 710728 | BNIP3OLIGO710728 100 UG | ¥3,921.00 | 100 UG |
Thermo-life | 710730 | FOXA2OLIGO710730 100 UG | ¥3,921.00 | 100 UG |
Thermo-life | 710731 | FRIZZLED4(FZD4)OLIGO710731 100 UG | ¥3,921.00 | 100 UG |
Thermo-life | 710734 | JUNBOLIGO710734 UG | ¥3,921.00 | UG |
Thermo-life | 710756 | SMAD3(PSPS423/425)OLIGO710756 UG | ¥3,921.00 | UG |
Thermo-life | 710792 | METPY1349OLIGO710792 UG | ¥3,921.00 | UG |
Thermo-life | 710837 | CDC25A(PS18)OLIGO710837 100 UG | ¥3,921.00 | 100 UG |
Thermo-life | 710840 | CDK1PTPY14/15OLIGO710840 100 UG | ¥3,921.00 | 100 UG |
Thermo-life | 710867 | SHP2OLIGO710867 100 UG | ¥3,921.00 | 100 UG |
Thermo-life | 710888 | WNT2B/13OLIGO710888 100 UG | ¥3,921.00 | 100 UG |
Thermo-life | 710893 | WNT16OLIGO710893 100 UG | ¥3,921.00 | 100 UG |
Thermo-life | 710912 | H2BOLIGO710912 UG | ¥3,921.00 | UG |
Thermo-life | 710952 | MSSCA1LY6AEOLIGO710952 UG | ¥3,921.00 | UG |
Thermo-life | 710982 | THOLIGO710982 100 UG | ¥3,921.00 | 100 UG |
Thermo-life | 711061 | CAS9OLIGO711061 100 UG | ¥3,921.00 | 100 UG |
Thermo-life | 720054 | WNT1 POLY720054 100 UG | ¥3,921.00 | 100 UG |
Thermo-life | 720060 | DISHEVELEDDVL2POLY720060 UG | ¥3,921.00 | UG |
Thermo-life | 720062 | FRIZZLED4POLY720062 UG | ¥3,921.00 | UG |
Thermo-life | 720065 | BTKPOLY720065 UG | ¥3,921.00 | UG |
Thermo-life | 720081 | H3K79ME1POLY720081 UG | ¥3,921.00 | UG |
Thermo-life | 720082 | H3K79ACPOLY720082 100 UG | ¥3,921.00 | 100 UG |
Thermo-life | 720094 | H3K14ACPOLY720094 UG | ¥3,921.00 | UG |
Thermo-life | 720098 | H3K27ME2POLY720098 100 UG | ¥3,921.00 | 100 UG |
Thermo-life | 720100 | HISTONEH4PS1POLY720100 100 UG | ¥3,921.00 | 100 UG |
Thermo-life | 720121 | PROFILIN1POLY720121 UG | ¥3,921.00 | UG |
Thermo-life | 720123 | KINDLIN/FERMT1POLY720123 UG | ¥3,921.00 | UG |
Thermo-life | 720128 | FOXO3APOLY720128 100 UG | ¥3,921.00 | 100 UG |
Thermo-life | 720133 | KMT2APOLY720133 100 UG | ¥3,921.00 | 100 UG |
Thermo-life | 720138 | ATAD2POLY720138 UG | ¥3,921.00 | UG |
Thermo-life | 720139 | TIP60POLY720139 UG | ¥3,921.00 | UG |
Thermo-life | 720140 | PRMT1POLY720140 100 UG | ¥3,921.00 | 100 UG |
Thermo-life | 720141 | PRMT2POLY720141 UG | ¥3,921.00 | UG |
Thermo-life | 720154 | FOXO4POLY720154 100 UG | ¥3,921.00 | 100 UG |
Thermo-life | 720155 | SOX15POLY720155 UG | ¥3,921.00 | UG |
Thermo-life | 720156 | SOX21POLY720156 UG | ¥3,921.00 | UG |
Thermo-life | 720161 | ANNEXINA6POLY720161 UG | ¥3,921.00 | UG |
Thermo-life | 720169 | ALDH1L1POLY720169 UG | ¥3,921.00 | UG |
Thermo-life | A10442 | ALEXA FLUOR 594 HYDRAZ 125 UL | ¥3,921.00 | 125 UL |
Thermo-life | MA1165 | LAMP2 MONOCLONAL ANTIBODY 100 UG | ¥3,921.00 | 100 UG |
Thermo-life | MA1177 | BACE1 ANTIBODY 100 UG | ¥3,921.00 | 100 UG |
Thermo-life | MA1189 | TBP MONOCLONAL ANTIBODY 100 UG | ¥3,921.00 | 100 UG |
Thermo-life | MA3017 | CRABP2 ANTIBODY (5CRA-3B3) 100 UG | ¥3,921.00 | 100 UG |
Thermo-life | MA3031 | GAL4 DBD ANTIBODY 100 UG | ¥3,921.00 | 100 UG |
Thermo-life | MA3038 | GSK-3 (4G1E) ANTIBODY 100 UG | ¥3,921.00 | 100 UG |
Thermo-life | MA3045 | MBP ANTIBODY (17TF2-1H4) 100 UG | ¥3,921.00 | 100 UG |
Thermo-life | MA3050 | HISTONE H4 ANTIBODY (3HH4-4G8) 100 UG | ¥3,921.00 | 100 UG |
Thermo-life | MA3058 | ACETYL HISTONE H4 LYS12 AB 100 UG | ¥3,921.00 | 100 UG |
Thermo-life | MA518338 | ACAT2 ANTIBODY (4A5) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA518344 | ACTL6A ANTIBODY (3C4) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA518359 | ADH6 ANTIBODY (4G4) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA518367 | AK1 ANTIBODY (3G8-1B11) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA518375 | ALDH3B2 ANTIBODY (3E6) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA518394 | AMY2B ANTIBODY (2B12) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA518404 | NUDT2 ANTIBODY (S1) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA518444 | ATF3 ANTIBODY (7G10) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA518449 | ATOH1 ANTIBODY (4H2) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA518452 | ATOX1 ANTIBODY (4A12) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA518455 | ATP1B3 ANTIBODY (2F4) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA518468 | ATP7B ANTIBODY (3A12) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA518469 | ATRX ANTIBODY (5B3) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA518489 | BMP7 ANTIBODY (2D6) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA518491 | POLR3D ANTIBODY (4E6) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA518492 | BNIP1 ANTIBODY (1G7) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA518513 | CA4 ANTIBODY (4G6) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA518532 | CAMK2D ANTIBODY (4F9) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA518533 | CAMLG ANTIBODY (3F12) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA518542 | SERPINA6 ANTIBODY (3B12) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA518550 | CCNG1 ANTIBODY (1E3) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA518575 | CDX4 ANTIBODY (1E9) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA518612 | CLK3 ANTIBODY (1H2) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA518633 | COX15 ANTIBODY (2D2) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA518634 | CPA1 ANTIBODY (3F11) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA518635 | CPA2 ANTIBODY (2E11) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA518651 | CRYBB1 ANTIBODY (2B2) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA518655 | CRYGD ANTIBODY (2H3) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA518666 | CSTF1 ANTIBODY (1C6) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA518668 | CSTF2 ANTIBODY (4E3-3C9) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA518671 | NKX2-5 ANTIBODY (4B11) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA518699 | DAP ANTIBODY (3C5) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA518705 | DCK ANTIBODY (2F10) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA518728 | SEPT1 ANTIBODY (1F12) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA518735 | DLX1 ANTIBODY (1D11) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA518739 | DLX2 ANTIBODY (3H3) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA518756 | DPH2 ANTIBODY (3F7) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA518759 | DPYS ANTIBODY (3B1) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA518771 | DTNB ANTIBODY (1D3) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA518784 | E2F6 ANTIBODY (1F7-A9) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA518796 | EIF2D ANTIBODY (2D10) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA518797 | EFNA3 ANTIBODY (1C12) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA518821 | EMX2 ANTIBODY (4D8) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA518833 | EPHB3 ANTIBODY (4E9) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA518862 | FANCB ANTIBODY (2B10) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA518886 | GPC5 ANTIBODY (1C9) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA518893 | FHL3 ANTIBODY (2C10) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA518898 | FOXF2 ANTIBODY (3D11) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA518923 | KDSR ANTIBODY (2B2-3C11) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA518941 | GAMT ANTIBODY (3H4) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA518967 | GK2 ANTIBODY (3G4) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA518968 | GK3P ANTIBODY (2H4) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA518977 | GLRA1 ANTIBODY (4D6) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA518997 | GPD1 ANTIBODY (3C10-1C4) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA519027 | GSTM5 ANTIBODY (1B3) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA519032 | GTF2A1 ANTIBODY (2H5) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA519040 | GTF3A ANTIBODY (4B4) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA519046 | GUK1 ANTIBODY (4C3-1A7) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA519067 | HELLS ANTIBODY (1D10) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA519072 | HHEX ANTIBODY (2B12) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA519073 | UBE2K ANTIBODY (1D10) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA519103 | HOXA5 ANTIBODY (1D12) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA519104 | HOXA5 ANTIBODY (2C9) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA519105 | HOXA6 ANTIBODY (3A6) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA519110 | HOXB1 ANTIBODY (2F12) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA519111 | HOXB1 ANTIBODY (2E5) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA519112 | HOXB5 ANTIBODY (3F10) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA519117 | HOXB9 ANTIBODY (2E8) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA519146 | HSF4 ANTIBODY (4F10) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA519150 | HSPA2 ANTIBODY (3H7) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA519151 | HSPA2 ANTIBODY (2D11) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA519153 | HSPA4 ANTIBODY (3A11) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA519169 | ID1 ANTIBODY (3A9) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA519170 | ID1 ANTIBODY (3F3) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA519171 | ID1 ANTIBODY (4F6) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA519176 | IDH3G ANTIBODY (2A2-1D3) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA519186 | IFNA6 ANTIBODY (3C9) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA519204 | IMPA1 ANTIBODY (1E6-F11) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA519208 | ING1 ANTIBODY (3E7) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA519210 | INPP1 ANTIBODY (1A6) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA519238 | KHK ANTIBODY (S1) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA519253 | LAMC1 ANTIBODY (M1) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA519262 | LFNG ANTIBODY (4F8) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA519290 | SMAD9 ANTIBODY (3H2) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA519313 | MCM3 ANTIBODY (2H3) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA519353 | MPG ANTIBODY (2C5) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA519354 | MPG ANTIBODY (1G6) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA519360 | CITED1 ANTIBODY (2H6) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA519372 | MTCP1 ANTIBODY (1G12) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA519380 | TRIM37 ANTIBODY (2D11) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA519412 | NUBP1 ANTIBODY (2B11) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA519419 | NDUFA2 ANTIBODY (6E7) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA519423 | NEB ANTIBODY (1F4) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA519432 | NDUFS4 ANTIBODY (3F11) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA519452 | NFIC ANTIBODY (1D6) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA519463 | NHLH2 ANTIBODY (2A3) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA519464 | NHP2L1 ANTIBODY (5C5) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA519493 | NTF4 ANTIBODY (1G12) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA519498 | NVL ANTIBODY (3F6) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA519508 | ORC4 ANTIBODY (2A8) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA519515 | OVOL1 ANTIBODY (1B3) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA519522 | PAFAH1B1 ANTIBODY (5A5) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA519555 | PDE3B ANTIBODY (4A4) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA519594 | PHKG2 ANTIBODY (2B8) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA519595 | PHYH ANTIBODY (1F2-5B9) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA519600 | PIGC ANTIBODY (1G2) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA519601 | PIGH ANTIBODY (2F8) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA519629 | PLEK ANTIBODY (2D8) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA519636 | PLSCR1 ANTIBODY (3B4) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA519698 | PRKACB AB (2G8-1D12) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA519701 | PRKCD ANTIBODY (8E12) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA519711 | MAP2K5 ANTIBODY (1E5) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA519712 | MAP2K5 ANTIBODY (2C2) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA519759 | PTPRN2 ANTIBODY (8E12) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA519769 | PYGM ANTIBODY (3D8) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA519779 | RABIF ANTIBODY (3A6) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA519797 | RBMS1 ANTIBODY (3F2-2G9) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA519798 | RBMS2 ANTIBODY (3B12) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA519805 | RECQL ANTIBODY (4D5) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA519814 | RFXAP ANTIBODY (1B5) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA519822 | RIT2 ANTIBODY (3F2) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA519823 | RING1 ANTIBODY (1F4) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA519824 | RING1 ANTIBODY (2D5) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA519830 | RNPEP ANTIBODY (4E1) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA519841 | RPL17 ANTIBODY (3G11) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA519847 | RPL32 ANTIBODY (1B11) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA519852 | RPN1 ANTIBODY (4B1-1E6) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA519861 | RPS9 ANTIBODY (2D3) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA519867 | RPS20 ANTIBODY (1G12) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA519876 | RTN2 ANTIBODY (6A11) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA519902 | SCTR ANTIBODY (3H1) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA519947 | SIX3 ANTIBODY (4H6) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA519983 | SNAPC4 ANTIBODY (3F10) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA519999 | SOX12 ANTIBODY (4A9) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA520003 | SP3 ANTIBODY (4E5) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA520016 | SRM ANTIBODY (2C1) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA520028 | SSR2 ANTIBODY (4C1) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA520043 | STK3 ANTIBODY (1E9) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA520069 | TAF13 ANTIBODY (2B3) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA520071 | TAP1 ANTIBODY (3D4) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA520076 | TAZ ANTIBODY (2B3) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA520125 | KLF10 ANTIBODY (3E11) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA520139 | TNR ANTIBODY (1D12) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA520232 | YES1 ANTIBODY (3C6) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA520238 | ZIC1 ANTIBODY (1A8) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA520240 | ZIC3 ANTIBODY (2G1) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA520242 | ZNF7 ANTIBODY (6F2) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA520249 | ZNF23 ANTIBODY (2D3) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA520253 | ZSCAN20 ANTIBODY (2C7) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA520255 | ZKSCAN1 ANTIBODY (2C7) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA520257 | ZSCAN21 ANTIBODY (4B11) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA520258 | ZNF41 ANTIBODY (2D8) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA520262 | ZNF70 ANTIBODY (1D8) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA520268 | MKRN3 ANTIBODY (2E10) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA520271 | ZNF136 ANTIBODY (5E9) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA520275 | PCGF2 ANTIBODY (3E4) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA520283 | TRIM26 ANTIBODY (1G3) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA520286 | ZNF180 ANTIBODY (4F3) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA520289 | ZKSCAN8 ANTIBODY (3B10) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA520291 | ZNF202 ANTIBODY (1E9) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA520293 | ZNF213 ANTIBODY (5D7) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA520294 | ZNF213 ANTIBODY (3D3) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA520295 | ZNF214 ANTIBODY (8E7) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA520296 | ZNF215 ANTIBODY (2C11) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA520297 | ZNF224 ANTIBODY (2C12) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA520298 | ZNF232 ANTIBODY (1F8) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA520357 | ZRSR2 ANTIBODY (2H5) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA520360 | USP9X ANTIBODY (4B7) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA520379 | NME5 ANTIBODY (4F5) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA520435 | BLZF1 ANTIBODY (2E10) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA520447 | AKR7A2 ANTIBODY (2H3) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA520460 | EIF4EBP3 ANTIBODY (1E3) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA520471 | EIF3I ANTIBODY (3B10) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA520523 | HESX1 ANTIBODY (2C4) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA520547 | MCM3AP ANTIBODY (1H3) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA520551 | BUD31 ANTIBODY (1E10) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA520556 | AP1S2 ANTIBODY (3B9-G5) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA520569 | CDKL2 ANTIBODY (6H8) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA520574 | CLIC3 ANTIBODY (2C5) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA520597 | PKMYT1 ANTIBODY (2A3) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA520630 | RASSF9 ANTIBODY (2F8) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA520659 | AIMP1 ANTIBODY (1C11) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA520685 | TAOK2 ANTIBODY (2F4) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA520718 | MED23 ANTIBODY (4H6) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA520744 | PIGL ANTIBODY (2B6) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA520758 | BAG4 ANTIBODY (2G9) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA520761 | POLR1C ANTIBODY (2A5-A5) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA520762 | PTGES ANTIBODY (2B9) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA520771 | NR1D1 ANTIBODY (2G6) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA520772 | NR1D1 ANTIBODY (1F4) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA520796 | GUCA1C ANTIBODY (3F10) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA520799 | MTL5 ANTIBODY (4H4) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA520807 | EIF5B ANTIBODY (3F9) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA520814 | PCDHGA8 ANTIBODY (1C11) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA520825 | SNPH ANTIBODY (3B6) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA520826 | PCDHA9 ANTIBODY (3C1) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA520827 | ZSCAN12 ANTIBODY (3E4) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA520866 | OXSR1 ANTIBODY (2E9) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA520867 | OXSR1 ANTIBODY (1F6) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA520890 | MED16 ANTIBODY (3B10) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA520895 | SH2D3C ANTIBODY (2E3) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA520896 | SH2D3C ANTIBODY (1B6) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA520897 | SH2D3A ANTIBODY (3B11) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA520917 | USH1C ANTIBODY (2B3) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA520931 | SGK2 ANTIBODY (2F6) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA520934 | ACTR1B ANTIBODY (4E10) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA520935 | ACTR1A ANTIBODY (3E5) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA520938 | RBM12 ANTIBODY (1D12) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA520944 | CHST4 ANTIBODY (4D7) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA520946 | ZNF197 ANTIBODY (3C11) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA520951 | RBM6 ANTIBODY (3E9) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA520956 | TSHZ1 ANTIBODY (2F1) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA520967 | TOPORS ANTIBODY (4G4) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA520977 | RABEPK ANTIBODY (4C9) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA520999 | TRAIP ANTIBODY (2E7) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA521003 | DLEU1 ANTIBODY (2C2) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA521004 | SNAPC5 ANTIBODY (5C3) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA521008 | KLHL41 ANTIBODY (1H3) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA521011 | B3GNT3 ANTIBODY (1A2) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA521012 | CLEC4M ANTIBODY (2G1) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA521013 | ABCA10 ANTIBODY (8F4) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA521014 | NPM3 ANTIBODY (3F2) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA521035 | TESK2 ANTIBODY (5H4) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA521044 | OLFM1 ANTIBODY (2G12-1B3) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA521045 | LRRN2 ANTIBODY (6A9) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA521069 | DEAF1 ANTIBODY (3E6) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA521070 | DEAF1 ANTIBODY (2A2) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA521089 | DPYSL4 ANTIBODY (1F5) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA521096 | AHSA1 ANTIBODY (4F3-B6) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA521106 | TRIM16 ANTIBODY (5F4) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA521116 | LBX1 ANTIBODY (2B2) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA521144 | PHTF1 ANTIBODY (3B7) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA521156 | ZNF266 ANTIBODY (4G5) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA521159 | ZNF274 ANTIBODY (1D8) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA521172 | PPP1R17 ANTIBODY (3E6) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA521178 | HCP5 ANTIBODY (3G7) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA521179 | CD300C ANTIBODY (2A10) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA521186 | BRD8 ANTIBODY (3G8) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA521189 | SUGT1 ANTIBODY (1A10) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA521195 | FASTK ANTIBODY (2B7) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA521203 | CBX1 ANTIBODY (4E12) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA521211 | COPS6 ANTIBODY (2H5) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA521229 | GTF2A1L ANTIBODY (2E3) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA521230 | GTF2A1L ANTIBODY (6F5) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA521231 | STON1 ANTIBODY (1F3) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA521251 | ADAM30 ANTIBODY (3E5) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA521265 | CAPN11 ANTIBODY (2G2) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA521268 | PWP1 ANTIBODY (3A11) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA521282 | RABL2B ANTIBODY (1B10) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA521285 | NUDT3 ANTIBODY (3C5) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA521297 | ANXA10 ANTIBODY (1F9) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA521300 | PROSC ANTIBODY (2G1) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA521310 | RNF24 ANTIBODY (4C6) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA521314 | NXPH3 ANTIBODY (4C8) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA521318 | CHORDC1 ANTIBODY (3G8) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA521323 | TREX1 ANTIBODY (1B1) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA521324 | KLF12 ANTIBODY (3D2) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA521327 | POU6F2 ANTIBODY (8F9) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA521342 | EXOSC8 ANTIBODY (4B3) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA521347 | TFEC ANTIBODY (4F11) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA521351 | RASA3 ANTIBODY (1F11) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA521354 | NLGN4Y ANTIBODY (2F7) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA521365 | ZNF365 ANTIBODY (2E3) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA521370 | MSRB2 ANTIBODY (3F12) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA521390 | EXOSC7 ANTIBODY (2F10) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA521391 | FAIM2 ANTIBODY (2C2) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA521419 | LPIN1 ANTIBODY (3D9) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA521425 | ATP11B ANTIBODY (4H8) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA521429 | RHOBTB2 ANTIBODY (2G6) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA521431 | PLCL2 ANTIBODY (1C7) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA521433 | SIK2 ANTIBODY (4C6) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA521436 | DNMBP ANTIBODY (1H2) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA521439 | ANKS1A ANTIBODY (6B11) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA521444 | SIN3B ANTIBODY (2C11) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA521467 | COMMD3 ANTIBODY (2E2) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA521468 | NCS1 ANTIBODY (3E7) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA521475 | SLC35A3 ANTIBODY (4B6) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA521478 | ABCB9 ANTIBODY (4F4) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA521494 | SEC14L2 ANTIBODY (2E5) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA521504 | DDAH2 ANTIBODY (3E3) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA521509 | CDC42EP4 ANTIBODY (3G10) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA521514 | FAM215A ANTIBODY (6D11) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA521530 | SSBP3 ANTIBODY (3E6) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA521532 | POLA2 ANTIBODY (2A8) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA521551 | FLRT1 ANTIBODY (4E10) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA521555 | CBY1 ANTIBODY (2F2) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA521589 | NUDT13 ANTIBODY (1A9) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA521591 | CHMP2B ANTIBODY (2H6-1E6) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA521593 | REXO2 ANTIBODY (2B5) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA521603 | ANKRD17 ANTIBODY (1D12) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA521610 | WSB1 ANTIBODY (3E10) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA521614 | TRPC4AP ANTIBODY (3G4) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA521620 | GIMAP2 ANTIBODY (1E10) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA521626 | FBXW4P1 ANTIBODY (2C5) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA521639 | FBXO4 ANTIBODY (2F2) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA521645 | SERGEF ANTIBODY (1A2) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA521649 | LHX6 ANTIBODY (2A2) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA521660 | ITGB1BP2 ANTIBODY (3G9) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA521686 | STAU2 ANTIBODY (3B7) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA521690 | KCNMB3 ANTIBODY (3E5) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA521709 | SULT1C4 ANTIBODY (4D9) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA521714 | LSM1 ANTIBODY (4F7) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA521720 | TP53TG5 ANTIBODY (3C2) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA521735 | KCNMB4 ANTIBODY (1G7) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA521737 | APOBEC3C ANTIBODY (3E6) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA521764 | N6AMT1 ANTIBODY (1C4) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA521771 | PRSS50 ANTIBODY (2D8) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA521779 | UQCR10 ANTIBODY (2B5) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA521788 | SNX11 ANTIBODY (2G1) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA521797 | POMT2 ANTIBODY (1D9) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA521820 | TAX1BP3 ANTIBODY (1H5) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA521835 | DHH ANTIBODY (2G5) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA521843 | TPRKB ANTIBODY (3F6) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA521862 | TRIM17 ANTIBODY (2E11) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA521864 | ASB3 ANTIBODY (3E5) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA521880 | RAPGEFL1 ANTIBODY (4G2) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA521886 | SHISA5 ANTIBODY (3G5) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA521892 | PIPOX ANTIBODY (3D1) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA521894 | DNAJC27 ANTIBODY (3C1) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA521897 | SCAND1 ANTIBODY (2F11) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA521899 | RXFP3 ANTIBODY (1F10) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA521907 | SPG21 ANTIBODY (2B11) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA521923 | TRAPPC4 ANTIBODY (2D5) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA521924 | HSFX1 ANTIBODY (1D7) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA521938 | GPR89B ANTIBODY (4D8) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA521948 | NCKIPSD ANTIBODY (2E4) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA521951 | PHF7 ANTIBODY (1E9) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA521953 | SCLY ANTIBODY (3B2) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA521956 | MBIP ANTIBODY (2E2) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA521960 | GDE1 ANTIBODY (2H6) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA521967 | MRPL48 ANTIBODY (1H8) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA521970 | GINS2 ANTIBODY (3H4) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA521976 | ZNF44 ANTIBODY (4E2) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA521977 | FBXO40 ANTIBODY (2E5) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA522014 | CHRAC1 ANTIBODY (4B8) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA522031 | ZDHHC13 ANTIBODY (2A4) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA522042 | SCAND2P ANTIBODY (5F1) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA522064 | DYM ANTIBODY (1C2) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA522081 | SOHLH2 ANTIBODY (1E1) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA522082 | RNF125 ANTIBODY (1D3) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA522090 | PIH1D1 AB (4F5-1E10) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA522110 | ARMC1 ANTIBODY (3F7-A6) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA522114 | MSL2 ANTIBODY (3A4) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA522124 | PANK4 ANTIBODY (4F10) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA522129 | WDR41 ANTIBODY (1F3) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA522135 | GIMAP4 ANTIBODY (1D8) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA522139 | FBXL8 ANTIBODY (2E1) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA522144 | PI4K2A ANTIBODY (3E1) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA522149 | ETNK1 ANTIBODY (3F11) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA522177 | NLRP2 ANTIBODY (1B10) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA522197 | TDP1 ANTIBODY (2A10-G2) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA522201 | METTL2B ANTIBODY (2A9) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA522212 | CENPJ ANTIBODY (1A5) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA522215 | ITFG2 ANTIBODY (3D7) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA522222 | LMO3 ANTIBODY (3G7) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA522223 | ZKSCAN7 ANTIBODY (3A12) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA522245 | PCDHGC5 ANTIBODY (3A6) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA522246 | PCDHGB2 ANTIBODY (6E9) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA522247 | PCDHGA10 ANTIBODY (3A7) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA522248 | PCDHGA9 ANTIBODY (1G10) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA522249 | PCDHGA5 ANTIBODY (5H5) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA522250 | PCDHGA2 ANTIBODY (2A7) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA522254 | PCDHB11 ANTIBODY (4F11) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA522256 | PCDHB6 ANTIBODY (2G11) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA522259 | PCDHA12 ANTIBODY (1D3) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA522265 | PCDHA2 ANTIBODY (2G12) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA522266 | PCDHA1 ANTIBODY (3A3) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA522272 | ZNF253 ANTIBODY (1D7) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA522274 | RNF20 ANTIBODY (1C6) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA522298 | PAPOLB ANTIBODY (3D7) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA522320 | CABP4 ANTIBODY (5G11) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA522327 | TRIM49 ANTIBODY (2E5) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA522336 | ADCK1 ANTIBODY (1E8) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA522347 | SPRYD7 ANTIBODY (2G4) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA522351 | ZNF287 ANTIBODY (3A2) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA522352 | ZNF287 ANTIBODY (3E12) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA522353 | SENP7 ANTIBODY (2D4) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA522371 | MTA3 ANTIBODY (3B3) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA522383 | ZNF398 ANTIBODY (4G3) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA522391 | VPS18 ANTIBODY (4E9) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA522392 | SH3RF1 ANTIBODY (1F7) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA522396 | COL20A1 ANTIBODY (1F5) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA522402 | LRRC4C ANTIBODY (1G5) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA522408 | NCOA5 ANTIBODY (1E9) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA522411 | RBAK ANTIBODY (6F9) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA522417 | SLC46A2 ANTIBODY (2F7) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA522424 | ZNF71 ANTIBODY (3F4) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA522431 | ENPP5 ANTIBODY (1C5-1D7) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA522442 | TGIF2 ANTIBODY (4B10) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA522450 | ZFAND3 ANTIBODY (2D2) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA522462 | RBKS ANTIBODY (3B4) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA522476 | LHX5 ANTIBODY (2A8) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA522484 | ZSCAN31 ANTIBODY (4F7) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA522489 | LMBR1 ANTIBODY (4A1) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA522490 | HS1BP3 ANTIBODY (1E2) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA522514 | IQCH ANTIBODY (4H3) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA522523 | CENPH ANTIBODY (1F7) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA522532 | COA7 ANTIBODY (1G11-1C4) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA522540 | ZSCAN18 ANTIBODY (2H1) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA522546 | BOLL ANTIBODY (2G4) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA522554 | KXD1 ANTIBODY (4C9) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA522569 | FSD1 ANTIBODY (1G3) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA522576 | BCL2L14 ANTIBODY (1D11) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA522582 | GALNT14 ANTIBODY (2A8) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA522583 | PANK3 ANTIBODY (3D7) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA522587 | ZMAT4 ANTIBODY (2A4) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA522590 | PRKRIP1 AB (4D11-3F11) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA522592 | NPEPL1 ANTIBODY (3F8-1A6) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA522597 | GEMIN7 ANTIBODY (4H6) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA522600 | SUGCT ANTIBODY (2B11) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA522604 | GEMIN6 ANTIBODY (3D2) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA522606 | LONRF3 ANTIBODY (1D5) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA522626 | ARL14 ANTIBODY (2C8) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA522628 | TRIM46 ANTIBODY (3G11) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA522635 | SPSB1 ANTIBODY (3E7) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA522646 | ZKSCAN3 ANTIBODY (2A1) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA522667 | POLR2M ANTIBODY (2E4) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA522687 | ZNF611 ANTIBODY (4F1) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA522690 | PCDH11Y ANTIBODY (1G5) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA522698 | NUDT12 ANTIBODY (3F7) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA522701 | CALN1 ANTIBODY (2G2) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA522704 | L3MBTL2 ANTIBODY (4F4) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA522709 | PRSS27 ANTIBODY (6F11) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA522729 | ZNF394 ANTIBODY (1F8) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA522730 | SNX29 ANTIBODY (6D6) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA522743 | CAMKK1 ANTIBODY (4A11) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA522745 | NTPCR ANTIBODY (2C3) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA522749 | ZNF397 ANTIBODY (1F8) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA522754 | DYDC2 ANTIBODY (8G4) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA522766 | RHOXF2 ANTIBODY (3C4) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA522767 | PGBD1 ANTIBODY (2A3) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA522795 | AIFM2 ANTIBODY (3A11) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA522800 | ZNF587 ANTIBODY (3A3) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA522808 | MPND ANTIBODY (1C12) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA522825 | RSPH1 ANTIBODY (3G6) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA522827 | NAV2 ANTIBODY (4D11) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA522830 | SLC25A21 ANTIBODY (2C9) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA522832 | LHX4 ANTIBODY (3B4) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA522840 | ZNF598 ANTIBODY (1E2) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA522843 | TRIM47 ANTIBODY (3C8) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA522849 | COL23A1 ANTIBODY (2C9) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA522853 | DEPDC7 ANTIBODY (4D9) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA522866 | SCGB3A1 ANTIBODY (3G5) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA522880 | ARMC6 ANTIBODY (2H8) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA522884 | CGB ANTIBODY (2E7) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA522893 | FOXQ1 ANTIBODY (2F2) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA522898 | TGS1 ANTIBODY (3F1) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA522900 | EGLN3 ANTIBODY (3C5) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA522905 | TP53RK ANTIBODY (3A1) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA522919 | CYGB ANTIBODY (3A5-2D2) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA522929 | GALNT13 ANTIBODY (3F3) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA522937 | HAUS1 ANTIBODY (1E3) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA522942 | ALPK2 ANTIBODY (4E5) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA522956 | OLIG1 ANTIBODY (2A4) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA522972 | FRA10AC1 ANTIBODY (2C4) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA522986 | SNX20 ANTIBODY (4E9) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA522987 | MSI2 ANTIBODY (3B6) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA522997 | FBXO27 ANTIBODY (1G6) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA523000 | ATP6V1G3 ANTIBODY (3A5) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA523009 | ACMSD ANTIBODY (3A9) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA523012 | OSR1 ANTIBODY (3B6) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA523016 | DNAJC19 ANTIBODY (3H4) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA523022 | GLYCTK ANTIBODY (1B5) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA523029 | POU5F2 ANTIBODY (3E3) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA523043 | PASD1 ANTIBODY (3C1) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA523047 | RNF113B ANTIBODY (2B11) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA523061 | SREK1 ANTIBODY (1D11) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA523063 | DYDC1 ANTIBODY (1B11) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA523070 | GSC ANTIBODY (1C2) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA523072 | MIPOL1 ANTIBODY (1B7) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA523079 | C18ORF23 ANTIBODY (3A1) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA523081 | HIPK4 ANTIBODY (2E8) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA523082 | ZNRF4 ANTIBODY (1A8) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA523084 | UBE2U ANTIBODY (3D4) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA523086 | DCST1 ANTIBODY (2C12) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA523088 | PDIK1L ANTIBODY (4B7) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA523092 | WFDC5 ANTIBODY (5G5) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA523095 | CCT8L2 ANTIBODY (1G8) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA523101 | SEPT10 ANTIBODY (2A12) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA523113 | CNTN4 ANTIBODY (4B10) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA523117 | PPP1R2P3 ANTIBODY (1H2) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA523120 | CNKSR3 ANTIBODY (4A11) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA523128 | RHOXF1 ANTIBODY (4D12) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA523142 | LONRF2 ANTIBODY (1C7) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA523144 | DCLK2 ANTIBODY (2A5) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA523148 | RNF133 ANTIBODY (3D6) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA523149 | STKL1 ANTIBODY (2B5) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA523183 | MS4A15 ANTIBODY (1D4) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA523184 | CCDC83 ANTIBODY (3E3) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA523185 | ATOH7 ANTIBODY (2B6) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA523186 | LOC220594 ANTIBODY (3A2) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA523189 | AK9 ANTIBODY (1H8) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA523197 | UNC5CL ANTIBODY (3G7) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA523205 | ZNF396 ANTIBODY (2F8) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA523216 | GK5 ANTIBODY (2C11) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA523238 | ZSCAN1 ANTIBODY (7C1) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA523246 | RNF212 ANTIBODY (5H3) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA523257 | ZNF181 ANTIBODY (5F1) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA523263 | UBE2DNL ANTIBODY (2F7) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA523268 | NACA2 ANTIBODY (4H6) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA523282 | DND1 ANTIBODY (1F7) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA523285 | CATIP ANTIBODY (2C3) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA523294 | RNF148 ANTIBODY (2D3) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA523296 | ZKSCAN4 ANTIBODY (1D2) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA523300 | CCL4L1 ANTIBODY (4G8) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA523311 | CENPP ANTIBODY (3G8) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA523313 | HAPLN4 ANTIBODY (1C1) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | MA523317 | IDNK ANTIBODY (1H4) 100 micrograms | ¥3,921.00 | 100 micrograms |
Thermo-life | PA540306 | GAS7 ANTIBODY 100 microliter | ¥3,921.00 | 100 microliter |
Thermo-life | PA540307 | C20ORF100 ANTIBODY 100 microliter | ¥3,921.00 | 100 microliter |
Thermo-life | PA540309 | ZNF341 ANTIBODY 100 microliter | ¥3,921.00 | 100 microliter |
Thermo-life | PA540311 | ZNF496 ANTIBODY 100 microliter | ¥3,921.00 | 100 microliter |
Thermo-life | PA540312 | SMARCA5 ANTIBODY 100 microliter | ¥3,921.00 | 100 microliter |
Thermo-life | PA540314 | GLIS2 ANTIBODY 100 microliter | ¥3,921.00 | 100 microliter |
Thermo-life | PA540315 | SPT3 ANTIBODY 100 microliter | ¥3,921.00 | 100 microliter |
Thermo-life | PA540316 | TEAD2 ANTIBODY 100 microliter | ¥3,921.00 | 100 microliter |
Thermo-life | PA540319 | UTF1 ANTIBODY 100 microliter | ¥3,921.00 | 100 microliter |
Thermo-life | PA540322 | ZNF394 ANTIBODY 100 microliter | ¥3,921.00 | 100 microliter |
Thermo-life | PA540323 | MIXL1 ANTIBODY 100 microliter | ¥3,921.00 | 100 microliter |
Thermo-life | PA540325 | L3MBTL2 ANTIBODY 100 microliter | ¥3,921.00 | 100 microliter |
Thermo-life | PA540326 | TFAP2D ANTIBODY 100 microliter | ¥3,921.00 | 100 microliter |
Thermo-life | PA540328 | GFI1B ANTIBODY 100 microliter | ¥3,921.00 | 100 microliter |
Thermo-life | PA540329 | EOMES ANTIBODY 100 microliter | ¥3,921.00 | 100 microliter |
Thermo-life | PA540330 | RBM10 ANTIBODY 100 microliter | ¥3,921.00 | 100 microliter |
Thermo-life | PA540331 | RBM10 ANTIBODY 100 microliter | ¥3,921.00 | 100 microliter |
Thermo-life | PA540332 | ELL ANTIBODY 100 microliter | ¥3,921.00 | 100 microliter |
Thermo-life | PA540333 | TSC22D4 ANTIBODY 100 microliter | ¥3,921.00 | 100 microliter |
Thermo-life | PA540335 | TAF15 ANTIBODY 100 microliter | ¥3,921.00 | 100 microliter |
Thermo-life | PA540337 | RGS4 ANTIBODY 100 microliter | ¥3,921.00 | 100 microliter |
Thermo-life | PA540340 | CLK4 ANTIBODY 100 microliter | ¥3,921.00 | 100 microliter |
Thermo-life | PA540341 | DYRK3 ANTIBODY 100 microliter | ¥3,921.00 | 100 microliter |
Thermo-life | PA540342 | GABRB1 ANTIBODY 100 microliter | ¥3,921.00 | 100 microliter |
Thermo-life | PA540344 | VAPA ANTIBODY 100 microliter | ¥3,921.00 | 100 microliter |
Thermo-life | PA540345 | CCL16 ANTIBODY 100 microliter | ¥3,921.00 | 100 microliter |
Thermo-life | PA540350 | ZEB1 ANTIBODY 100 microliter | ¥3,921.00 | 100 microliter |
Thermo-life | PA540351 | DMRT1 ANTIBODY 100 microliter | ¥3,921.00 | 100 microliter |
Thermo-life | PA540352 | TFCP2 ANTIBODY 100 microliter | ¥3,921.00 | 100 microliter |
Thermo-life | PA540353 | ELF1 ANTIBODY 100 microliter | ¥3,921.00 | 100 microliter |
Thermo-life | PA540354 | RBPSUH ANTIBODY 100 microliter | ¥3,921.00 | 100 microliter |
Thermo-life | PA540355 | RFX3 ANTIBODY 100 microliter | ¥3,921.00 | 100 microliter |
Thermo-life | PA540357 | ISGF3G ANTIBODY 100 microliter | ¥3,921.00 | 100 microliter |
Thermo-life | PA540361 | FRA-1 ANTIBODY 100 microliter | ¥3,921.00 | 100 microliter |
Thermo-life | PA540364 | HOXB6 ANTIBODY 100 microliter | ¥3,921.00 | 100 microliter |
Thermo-life | PA540367 | MSX2 ANTIBODY 100 microliter | ¥3,921.00 | 100 microliter |
Thermo-life | PA540370 | TAF10 ANTIBODY 100 microliter | ¥3,921.00 | 100 microliter |
Thermo-life | PA540372 | GTF2F2 ANTIBODY 100 microliter | ¥3,921.00 | 100 microliter |
Thermo-life | PA540373 | GTF2F2 ANTIBODY 100 microliter | ¥3,921.00 | 100 microliter |
Thermo-life | PA540374 | GTF2H3 ANTIBODY 100 microliter | ¥3,921.00 | 100 microliter |
Thermo-life | PA540375 | HOXB5 ANTIBODY 100 microliter | ¥3,921.00 | 100 microliter |
Thermo-life | PA540376 | PQBP1 ANTIBODY 100 microliter | ¥3,921.00 | 100 microliter |
Thermo-life | PA540378 | YAF2 ANTIBODY 100 microliter | ¥3,921.00 | 100 microliter |
Thermo-life | PA540382 | TADA3L ANTIBODY 100 microliter | ¥3,921.00 | 100 microliter |
Thermo-life | PA540384 | TCFL5 ANTIBODY 100 microliter | ¥3,921.00 | 100 microliter |
Thermo-life | PA540385 | ZNF274 ANTIBODY 100 microliter | ¥3,921.00 | 100 microliter |
Thermo-life | PA540388 | SUPT16H ANTIBODY 100 microliter | ¥3,921.00 | 100 microliter |
Thermo-life | PA540389 | EAP30 ANTIBODY 100 microliter | ¥3,921.00 | 100 microliter |
Thermo-life | PA540390 | KLF8 ANTIBODY 100 microliter | ¥3,921.00 | 100 microliter |
Thermo-life | PA540391 | AEBP2 ANTIBODY 100 microliter | ¥3,921.00 | 100 microliter |
Thermo-life | PA540399 | CREBL1 ANTIBODY 100 microliter | ¥3,921.00 | 100 microliter |
Thermo-life | PA540402 | ZFP90 ANTIBODY 100 microliter | ¥3,921.00 | 100 microliter |
Thermo-life | PA540404 | ZFP1 ANTIBODY 100 microliter | ¥3,921.00 | 100 microliter |
Thermo-life | PA540405 | DBP ANTIBODY 100 microliter | ¥3,921.00 | 100 microliter |
Thermo-life | PA540406 | AEBP1 ANTIBODY 100 microliter | ¥3,921.00 | 100 microliter |
Thermo-life | PA540407 | ARX ANTIBODY 100 microliter | ¥3,921.00 | 100 microliter |
Thermo-life | PA540408 | DLX2 ANTIBODY 100 microliter | ¥3,921.00 | 100 microliter |
Thermo-life | PA540409 | DLX5 ANTIBODY 100 microliter | ¥3,921.00 | 100 microliter |
Thermo-life | PA540411 | SP7 ANTIBODY 100 microliter | ¥3,921.00 | 100 microliter |
Thermo-life | PA540412 | ELF2 ANTIBODY 100 microliter | ¥3,921.00 | 100 microliter |
Thermo-life | PA540415 | ERF ANTIBODY 100 microliter | ¥3,921.00 | 100 microliter |
Thermo-life | PA540416 | FGD1 ANTIBODY 100 microliter | ¥3,921.00 | 100 microliter |
Thermo-life | PA540417 | ZNFN1A2 ANTIBODY 100 microliter | ¥3,921.00 | 100 microliter |
Thermo-life | PA540418 | ZNF652 ANTIBODY 100 microliter | ¥3,921.00 | 100 microliter |
Thermo-life | PA540419 | KIN ANTIBODY 100 microliter | ¥3,921.00 | 100 microliter |
Thermo-life | PA540421 | FBXL11 ANTIBODY 100 microliter | ¥3,921.00 | 100 microliter |
Thermo-life | PA540422 | FOXE1 ANTIBODY 100 microliter | ¥3,921.00 | 100 microliter |
Thermo-life | PA540423 | ZNF609 ANTIBODY 100 microliter | ¥3,921.00 | 100 microliter |
Thermo-life | PA540424 | FOXD2 ANTIBODY 100 microliter | ¥3,921.00 | 100 microliter |
Thermo-life | PA540426 | PDK2 ANTIBODY 100 microliter | ¥3,921.00 | 100 microliter |
Thermo-life | PA540428 | ZNF297B ANTIBODY 100 microliter | ¥3,921.00 | 100 microliter |
Thermo-life | PA540430 | HIC-2 ANTIBODY 100 microliter | ¥3,921.00 | 100 microliter |
Thermo-life | PA540431 | SSBP2 ANTIBODY 100 microliter | ¥3,921.00 | 100 microliter |
Thermo-life | PA540433 | C20ORF194 ANTIBODY 100 microliter | ¥3,921.00 | 100 microliter |
Thermo-life | PA540434 | ZNF385 ANTIBODY 100 microliter | ¥3,921.00 | 100 microliter |
Thermo-life | PA540435 | ZNF500 ANTIBODY 100 microliter | ¥3,921.00 | 100 microliter |
Thermo-life | PA540437 | NKX2-8 ANTIBODY 100 microliter | ¥3,921.00 | 100 microliter |
Thermo-life | PA540438 | GATA6 ANTIBODY 100 microliter | ¥3,921.00 | 100 microliter |
Thermo-life | PA540439 | MYCBP ANTIBODY 100 microliter | ¥3,921.00 | 100 microliter |
Thermo-life | PA540440 | EHF ANTIBODY 100 microliter | ¥3,921.00 | 100 microliter |
Thermo-life | PA540441 | GBX2 ANTIBODY 100 microliter | ¥3,921.00 | 100 microliter |
Thermo-life | PA540442 | AATF ANTIBODY 100 microliter | ¥3,921.00 | 100 microliter |
Thermo-life | PA540443 | GLI2 ANTIBODY 100 microliter | ¥3,921.00 | 100 microliter |
Thermo-life | PA540447 | ZC3H7A ANTIBODY 100 microliter | ¥3,921.00 | 100 microliter |
Thermo-life | PA540448 | GTF2H4 ANTIBODY 100 microliter | ¥3,921.00 | 100 microliter |
Thermo-life | PA540449 | TF3C-BETA ANTIBODY 100 microliter | ¥3,921.00 | 100 microliter |
Thermo-life | PA540451 | TFCP2L1 ANTIBODY 100 microliter | ¥3,921.00 | 100 microliter |
Thermo-life | PA540452 | RAX ANTIBODY 100 microliter | ¥3,921.00 | 100 microliter |
Thermo-life | PA540453 | HS1 / HCLS1 ANTIBODY 100 microliter | ¥3,921.00 | 100 microliter |
Thermo-life | PA540454 | CSEN ANTIBODY 100 microliter | ¥3,921.00 | 100 microliter |
Thermo-life | PA540455 | ZBTB48 ANTIBODY 100 microliter | ¥3,921.00 | 100 microliter |
Thermo-life | PA540456 | MNX1 ANTIBODY 100 microliter | ¥3,921.00 | 100 microliter |
Thermo-life | PA540459 | HOXA13 ANTIBODY 100 microliter | ¥3,921.00 | 100 microliter |
Thermo-life | PA540461 | HOXD3 ANTIBODY 100 microliter | ¥3,921.00 | 100 microliter |
Thermo-life | PA540463 | TFAP2E ANTIBODY 100 microliter | ¥3,921.00 | 100 microliter |
Thermo-life | PA540465 | BARHL2 ANTIBODY 100 microliter | ¥3,921.00 | 100 microliter |
Thermo-life | PA540467 | ZNF391 ANTIBODY 100 microliter | ¥3,921.00 | 100 microliter |
Thermo-life | PA540468 | ZNF81 ANTIBODY 100 microliter | ¥3,921.00 | 100 microliter |
Thermo-life | PA540471 | INSM1 ANTIBODY 100 microliter | ¥3,921.00 | 100 microliter |
Thermo-life | PA540472 | IRF6 ANTIBODY 100 microliter | ¥3,921.00 | 100 microliter |
Thermo-life | PA540473 | TRIM23 ANTIBODY 100 microliter | ¥3,921.00 | 100 microliter |
Thermo-life | PA540474 | ASCL2 ANTIBODY 100 microliter | ¥3,921.00 | 100 microliter |
Thermo-life | PA540475 | MTF-1 ANTIBODY 100 microliter | ¥3,921.00 | 100 microliter |
Thermo-life | PA540476 | NAB1 ANTIBODY 100 microliter | ¥3,921.00 | 100 microliter |
Thermo-life | PA540477 | NEUROD2 / NDRF ANTIBODY 100 microliter | ¥3,921.00 | 100 microliter |
Thermo-life | PA540478 | NEUROG1 ANTIBODY 100 microliter | ¥3,921.00 | 100 microliter |
Thermo-life | PA540479 | NOTCH4 ANTIBODY 100 microliter | ¥3,921.00 | 100 microliter |
Thermo-life | PA540481 | IRX4 ANTIBODY 100 microliter | ¥3,921.00 | 100 microliter |
Thermo-life | PA540482 | PBX3 ANTIBODY 100 microliter | ¥3,921.00 | 100 microliter |
Thermo-life | PA540483 | CGI-143 ANTIBODY 100 microliter | ¥3,921.00 | 100 microliter |
Thermo-life | PA540484 | TLX / NR2E1 ANTIBODY 100 microliter | ¥3,921.00 | 100 microliter |
Thermo-life | PA540485 | DVL1 ANTIBODY 100 microliter | ¥3,921.00 | 100 microliter |
Thermo-life | PA540486 | DVL2 ANTIBODY 100 microliter | ¥3,921.00 | 100 microliter |
Thermo-life | PA540488 | TAF11 ANTIBODY 100 microliter | ¥3,921.00 | 100 microliter |
Thermo-life | PA540489 | RNF12 ANTIBODY 100 microliter | ¥3,921.00 | 100 microliter |
Thermo-life | PA540493 | CREBL1 ANTIBODY 100 microliter | ¥3,921.00 | 100 microliter |
Thermo-life | PA540495 | GSC ANTIBODY 100 microliter | ¥3,921.00 | 100 microliter |
Thermo-life | PA540496 | ZNF639 ANTIBODY 100 microliter | ¥3,921.00 | 100 microliter |
Thermo-life | PA540497 | NT5C3 ANTIBODY 100 microliter | ¥3,921.00 | 100 microliter |
Thermo-life | PA540498 | ZNF746 ANTIBODY 100 microliter | ¥3,921.00 | 100 microliter |
Thermo-life | PA540500 | ZFPM1 ANTIBODY 100 microliter | ¥3,921.00 | 100 microliter |
Thermo-life | PA540501 | DBP ANTIBODY 100 microliter | ¥3,921.00 | 100 microliter |
Thermo-life | PA540504 | GSH2 ANTIBODY 100 microliter | ¥3,921.00 | 100 microliter |
Thermo-life | PA540505 | DLX2 ANTIBODY 100 microliter | ¥3,921.00 | 100 microliter |
Thermo-life | PA540506 | DLX3 ANTIBODY 100 microliter | ¥3,921.00 | 100 microliter |
Thermo-life | PA540507 | E2F6 ANTIBODY 100 microliter | ¥3,921.00 | 100 microliter |
Thermo-life | PA540508 | SOX30 ANTIBODY 100 microliter | ¥3,921.00 | 100 microliter |
Thermo-life | PA540509 | SP7 ANTIBODY 100 microliter | ¥3,921.00 | 100 microliter |
Thermo-life | PA540510 | OSR1 ANTIBODY 100 microliter | ¥3,921.00 | 100 microliter |
Thermo-life | PA540512 | ERF ANTIBODY 100 microliter | ¥3,921.00 | 100 microliter |
Thermo-life | PA540514 | ZNF365 ANTIBODY 100 microliter | ¥3,921.00 | 100 microliter |
Thermo-life | PA540516 | FOXF1 ANTIBODY 100 microliter | ¥3,921.00 | 100 microliter |
Thermo-life | PA540517 | THRAP5 ANTIBODY 100 microliter | ¥3,921.00 | 100 microliter |
Thermo-life | PA540518 | FOXL1 ANTIBODY 100 microliter | ¥3,921.00 | 100 microliter |
Thermo-life | PA540519 | FOXE3 ANTIBODY 100 microliter | ¥3,921.00 | 100 microliter |
Thermo-life | PA540522 | ID4 ANTIBODY 100 microliter | ¥3,921.00 | 100 microliter |
Thermo-life | PA540524 | BMP7 ANTIBODY 100 microliter | ¥3,921.00 | 100 microliter |
Thermo-life | PA540525 | EYA3 ANTIBODY 100 microliter | ¥3,921.00 | 100 microliter |
Thermo-life | PA540526 | NKX2.2 ANTIBODY 100 microliter | ¥3,921.00 | 100 microliter |
Thermo-life | PA540528 | TLE3 ANTIBODY 100 microliter | ¥3,921.00 | 100 microliter |
Thermo-life | PA540529 | TBX19 ANTIBODY 100 microliter | ¥3,921.00 | 100 microliter |
Thermo-life | PA540530 | SIX3 ANTIBODY 100 microliter | ¥3,921.00 | 100 microliter |
Thermo-life | PA540531 | LIM1 ANTIBODY 100 microliter | ¥3,921.00 | 100 microliter |
Thermo-life | PA540532 | SIX1 ANTIBODY 100 microliter | ¥3,921.00 | 100 microliter |
Thermo-life | PA540533 | TLE4 ANTIBODY 100 microliter | ¥3,921.00 | 100 microliter |
Thermo-life | PA540534 | SIX6 ANTIBODY 100 microliter | ¥3,921.00 | 100 microliter |
Thermo-life | PA540535 | SIRT5 ANTIBODY 100 microliter | ¥3,921.00 | 100 microliter |
Thermo-life | PA540537 | PSMD6 ANTIBODY 100 microliter | ¥3,921.00 | 100 microliter |
產(chǎn)品咨詢